/*
Theme Name: Medivo Agency
Theme URI: https://medivo.agency/
Author: medivo.agency
Author URI: https://medivo.agency/
Description: Editorial DVIZH-inspired multilingual WordPress theme for medivo.agency. PR, SMM, websites and communications for businesses, artists, event organizers, brands, NGOs and startups. No page builders.
Version: 1.17.7-language-home-sync
Requires at least: 6.0
Tested up to: 6.6
Requires PHP: 8.0
License: GPL-2.0-or-later
Text Domain: tf-agency-clear
*/

/* Font files are resolved dynamically by functions.php.
   The theme first checks assets/fonts and then the WordPress Media Library. */

:root {
  --tfac-font-body: "e-Ukraine";
  --tfac-font-head: "e-Ukraine Head";
  --tfac-font-logo: "e-Ukraine Head LOGO";

  --dark: #2d2d2d;
  --ink: #2d2d2d;
  --paper: #f3efe5;
  --paper-2: #f3efe5;
  --white: #f3efe5;
  --acid: #a7284d;
  --acid-2: #a7284d;
  --red: #a7284d;
  --accent-on-dark: #f3efe5;
  --accent-on-dark-strong: #f3efe5;

  --muted: #706f66;
  --line: #2d2d2d;
  --cream: var(--paper);
  --cream-2: var(--paper-2);
  --blue: var(--acid);
  --blue-2: var(--dark);
  --yellow: var(--acid);
  --green: var(--acid);
  --mint: var(--paper-2);
  --pink: var(--red);
  --radius: 0;
  --radius-lg: 0;
  --container: 1240px;
  --shadow: none;
  --shadow-soft: none;
}

* {
  box-sizing: border-box;
}
html {
  scroll-behavior: smooth;
  max-width: 100%;
  overflow-x: hidden;
}
body {
  margin: 0;
  min-width: 320px;
  max-width: 100%;
  overflow-x: hidden;
  background: var(--paper);
  color: var(--ink);
  font-family: var(--tfac-font-body);
  font-size: 16px;
  line-height: 1.42;
  -webkit-font-smoothing: antialiased;
  text-rendering: optimizeLegibility;
}
body.no-scroll {
  overflow: hidden;
}
a {
  color: inherit;
  text-decoration: none;
}
p,
h1,
h2,
h3,
ul {
  margin: 0;
}
img {
  max-width: 100%;
  height: auto;
}
button,
input,
select,
textarea {
  font: inherit;
}
section {
  scroll-margin-top: 92px;
}
.container {
  width: min(var(--container), calc(100% - 48px));
  margin-inline: auto;
}
.skip-link {
  position: absolute;
  left: -999px;
  top: auto;
}
.skip-link:focus {
  left: 16px;
  top: 16px;
  z-index: 9999;
  background: var(--acid);
  color: var(--ink);
  padding: 12px 18px;
  border: 2px solid var(--ink);
  text-transform: uppercase;
  font-weight: 900;
}
.sr-only,
.screen-reader-text {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  white-space: nowrap;
  border: 0;
}
::selection {
  background: var(--acid);
  color: var(--ink);
}

.site-header {
  position: sticky;
  top: 0;
  z-index: 1000;
  background: rgba(243, 239, 229, 0.94);
  backdrop-filter: blur(12px);
  border-bottom: 2px solid var(--ink);
  padding-top: env(safe-area-inset-top);
}
.header-inner {
  height: 76px;
  display: flex;
  align-items: center;
  gap: 18px;
}
.brand {
  display: inline-flex;
  align-items: center;
  gap: 12px;
  min-width: 0;
  font-weight: 900;
  text-transform: uppercase;
}
.brand-mark {
  height: 42px;
  min-width: 66px;
  display: grid;
  place-items: center;
  padding: 0 12px;
  background: var(--ink);
  color: var(--paper);
  border: 2px solid var(--ink);
  font-family: var(--tfac-font-logo);
  font-size: 14px;
  line-height: 0.9;
  letter-spacing: -0.08em;
}
.brand-text {
  display: grid;
  line-height: 0.95;
}
.brand-name {
  font-family: var(--tfac-font-head);
  font-size: 17px;
  font-weight: 950;
  letter-spacing: -0.05em;
}
.brand-sub {
  font-size: 10px;
  letter-spacing: 0.18em;
  color: var(--muted);
  font-weight: 900;
}
.main-nav {
  margin-left: auto;
  display: flex;
  align-items: center;
  gap: 0;
  border: 2px solid var(--ink);
  background: var(--paper-2);
}
.main-nav a {
  position: relative;
  display: flex;
  align-items: center;
  min-height: 42px;
  padding: 0 13px;
  border-right: 2px solid var(--ink);
  font-size: 11px;
  font-weight: 950;
  line-height: 1;
  text-transform: uppercase;
  letter-spacing: 0.06em;
}
.main-nav a:last-child {
  border-right: 0;
}
.main-nav a:hover {
  background: var(--acid);
}
.lang-switch {
  display: flex;
  align-items: center;
  border: 2px solid var(--ink);
  background: var(--paper-2);
}
.lang-switch a {
  display: grid;
  place-items: center;
  min-width: 36px;
  height: 36px;
  border-right: 2px solid var(--ink);
  font-size: 10px;
  font-weight: 950;
  text-transform: uppercase;
}
.lang-switch a:last-child {
  border-right: 0;
}
.lang-switch a.active {
  background: var(--ink);
  color: var(--paper);
}
.header-cta {
  height: 42px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  padding: 0 16px;
  border: 2px solid var(--ink);
  background: var(--acid);
  color: var(--ink);
  font-size: 11px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.05em;
  white-space: nowrap;
}
.header-cta:hover {
  background: var(--ink);
  color: var(--paper);
}
.menu-toggle {
  display: none;
  width: 46px;
  height: 46px;
  place-items: center;
  border: 2px solid var(--ink);
  background: var(--paper-2);
  font-size: 24px;
  cursor: pointer;
  color: var(--ink);
}

.hero {
  position: relative;
  overflow: hidden;
}
.agency-hero {
  padding: 82px 0 64px;
  background: var(--ink);
  color: var(--paper);
  border-bottom: 2px solid var(--ink);
}
.agency-hero:before {
  content: "";
  position: absolute;
  inset: 0;
  background-image:
    linear-gradient(rgba(243, 239, 229, 0.08) 1px, transparent 1px),
    linear-gradient(90deg, rgba(243, 239, 229, 0.08) 1px, transparent 1px);
  background-size: 72px 72px;
  mask-image: linear-gradient(to bottom, rgba(0, 0, 0, 0.85), transparent 92%);
  pointer-events: none;
}
.hero-orb,
.sticker {
  display: none !important;
}
.hero-grid {
  position: relative;
  z-index: 1;
  display: grid;
  grid-template-columns: minmax(0, 1.08fr) minmax(360px, 0.72fr);
  gap: 48px;
  align-items: end;
}
.hero-copy {
  position: relative;
}
.hero-badges {
  display: flex;
  flex-wrap: wrap;
  gap: 0;
  margin: 0 0 26px;
  border: 2px solid var(--paper);
  width: max-content;
  max-width: 100%;
}
.hero-badges span {
  display: inline-flex;
  align-items: center;
  min-height: 36px;
  padding: 0 13px;
  border-right: 2px solid var(--paper);
  background: transparent;
  color: var(--paper);
  font-size: 11px;
  font-weight: 950;
  line-height: 1;
  text-transform: uppercase;
  letter-spacing: 0.08em;
}
.hero-badges span:last-child {
  border-right: 0;
}
.hero-badges span:nth-child(2n) {
  background: var(--paper);
  color: var(--ink);
}
.eyebrow {
  display: inline-flex;
  align-items: center;
  gap: 9px;
  margin-bottom: 16px;
  color: var(--acid);
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.16em;
}
.eyebrow:before {
  content: "/";
  width: auto;
  height: auto;
  background: transparent;
  color: currentColor;
  font-size: 16px;
  line-height: 1;
}
.section-cream .eyebrow,
.section-white .eyebrow {
  color: var(--red);
}
.hero-display {
  font-family: var(--tfac-font-head);
  line-height: 0.82;
  letter-spacing: -0.09em;
  text-transform: uppercase;
  text-wrap: balance;
}
.hero-display span {
  display: block;
}
.hero-display-top {
  font-size: clamp(58px, 9.6vw, 138px);
  font-weight: 950;
  color: var(--paper);
}
.hero-display-bottom {
  display: block !important;
  margin-top: 12px;
  font-size: clamp(54px, 8.6vw, 122px);
  font-weight: 950;
  color: var(--acid);
  -webkit-text-stroke: 0;
  text-shadow: none;
  transform: none;
}
.lead {
  font-size: clamp(18px, 1.75vw, 22px);
  line-height: 1.45;
  color: var(--muted);
  font-weight: 700;
}
.hero-lead {
  max-width: 760px;
  margin-top: 34px;
  color: rgba(243, 239, 229, 0.78);
}
.hero-actions {
  display: flex;
  flex-wrap: wrap;
  gap: 12px;
  margin-top: 30px;
}
.btn {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  gap: 10px;
  min-height: 50px;
  padding: 13px 18px;
  border: 2px solid var(--ink);
  background: var(--paper-2);
  color: var(--ink);
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.08em;
  cursor: pointer;
  transition:
    background 0.15s ease,
    color 0.15s ease,
    transform 0.15s ease;
}
.btn:after {
  content: "/";
  font-weight: 950;
}
.btn:hover {
  background: var(--ink);
  color: var(--paper);
  transform: translateY(-1px);
}
.agency-hero .btn {
  border-color: var(--paper);
}
.agency-hero .btn:hover {
  background: var(--paper);
  color: var(--ink);
}
.btn-yellow {
  background: var(--acid);
  color: var(--ink);
}
.btn-dark {
  background: var(--ink);
  color: var(--paper);
}
.btn-ghost {
  background: transparent;
  color: var(--paper);
}
.section-cream .btn-ghost,
.section-white .btn-ghost {
  color: var(--ink);
  background: var(--paper-2);
}
.hero-note {
  display: flex;
  align-items: flex-start;
  gap: 12px;
  max-width: 640px;
  margin-top: 22px;
  color: rgba(243, 239, 229, 0.68);
  font-size: 14px;
  text-transform: uppercase;
  letter-spacing: 0.04em;
  font-weight: 800;
}
.note-dot {
  width: 10px;
  height: 10px;
  background: var(--acid);
  border-radius: 50%;
  flex: 0 0 auto;
  margin-top: 4px;
}

.impact-board {
  position: relative;
  display: grid;
  grid-template-columns: 1fr 1fr;
  min-height: 0;
  border: 2px solid var(--paper);
  background: rgba(243, 239, 229, 0.02);
  align-self: end;
}
.impact-card {
  position: static !important;
  grid-column: 1/-1;
  margin: 0 !important;
  padding: 24px;
  border: 0;
  border-bottom: 2px solid var(--paper);
  background: transparent;
  color: var(--paper);
  box-shadow: none;
  border-radius: 0;
  transform: none;
}
.impact-kicker {
  margin-bottom: 16px;
  color: var(--acid);
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.14em;
}
.simple-list {
  display: grid;
  gap: 12px;
  list-style: none;
  padding: 0;
}
.simple-list li {
  display: grid;
  grid-template-columns: 22px 1fr;
  gap: 10px;
  color: rgba(243, 239, 229, 0.8);
  font-weight: 800;
}
.tick {
  display: grid;
  place-items: center;
  width: 22px;
  height: 22px;
  background: var(--acid);
  color: var(--ink);
  font-size: 13px;
  font-weight: 950;
}
.impact-mini-grid {
  position: static !important;
  grid-column: 1/-1;
  display: grid;
  grid-template-columns: 1fr 1fr;
}
.mini-stat {
  min-height: 160px;
  padding: 22px;
  background: var(--paper);
  color: var(--ink);
  border: 0;
  border-right: 2px solid var(--ink);
  box-shadow: none;
  border-radius: 0;
}
.mini-stat:last-child {
  border-right: 0;
}
.mini-stat strong {
  display: block;
  color: var(--ink);
  font-family: var(--tfac-font-head);
  font-size: clamp(42px, 5vw, 74px);
  line-height: 0.9;
  font-weight: 950;
  letter-spacing: -0.08em;
}
.mini-stat span {
  display: block;
  max-width: 230px;
  margin-top: 14px;
  color: #1f1f1f;
  font-size: 14px;
  font-weight: 850;
  text-transform: uppercase;
  letter-spacing: 0.02em;
}
.ticker-wrap {
  overflow: hidden;
  background: var(--acid);
  color: var(--ink);
  border-block: 2px solid var(--ink);
}
.ticker-track {
  display: flex;
  gap: 0;
  width: max-content;
  animation: ticker 24s linear infinite;
}
.ticker-track span {
  display: inline-flex;
  align-items: center;
  min-height: 58px;
  padding: 0 26px;
  border-right: 2px solid var(--ink);
  font-family: var(--tfac-font-head);
  font-size: 20px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: -0.04em;
}
.ticker-track span:before {
  content: "/";
  margin-right: 12px;
}
@keyframes ticker {
  from {
    transform: translateX(0);
  }
  to {
    transform: translateX(-50%);
  }
}

.section {
  padding: 78px 0;
  border-bottom: 2px solid var(--ink);
  position: relative;
}
.section-cream {
  background: var(--paper);
}
.section-white {
  background: var(--paper-2);
}
.section-blue {
  background: var(--ink);
  color: var(--paper);
}
.section h2,
.directions-copy h2,
.manifesto-left h2 {
  font-family: var(--tfac-font-head);
  font-size: clamp(46px, 6.4vw, 96px);
  line-height: 0.86;
  letter-spacing: -0.085em;
  text-transform: uppercase;
  font-weight: 950;
  text-wrap: balance;
}
.section-head {
  display: grid;
  grid-template-columns: minmax(0, 1fr) minmax(300px, 0.48fr);
  gap: 42px;
  align-items: end;
  margin-bottom: 44px;
}
.section-head .lead {
  max-width: 560px;
}
.on-dark {
  color: rgba(243, 239, 229, 0.74);
}

.intro-grid {
  display: grid;
  grid-template-columns: minmax(0, 0.85fr) minmax(320px, 0.62fr);
  gap: 56px;
  align-items: end;
  margin-bottom: 32px;
}
.intro-proof {
  display: grid;
  grid-template-columns: 1fr 1fr;
  border: 2px solid var(--ink);
  background: var(--paper-2);
}
.proof-cell {
  min-height: 160px;
  padding: 22px;
  border-right: 2px solid var(--ink);
}
.proof-cell:nth-child(2) {
  border-right: 0;
}
.proof-cell strong {
  display: block;
  font-family: var(--tfac-font-head);
  font-size: clamp(42px, 5vw, 72px);
  line-height: 0.88;
  letter-spacing: -0.08em;
  text-transform: uppercase;
}
.proof-cell span {
  display: block;
  margin-top: 12px;
  color: var(--muted);
  font-size: 14px;
  font-weight: 850;
  text-transform: uppercase;
}
.proof-note {
  grid-column: 1/-1;
  padding: 22px;
  border-top: 2px solid var(--ink);
  background: var(--acid);
  font-weight: 950;
  text-transform: uppercase;
}
.audience-grid,
.case-grid,
.price-grid,
.steps,
.ecosystem-grid {
  display: grid;
  grid-template-columns: repeat(4, 1fr);
  gap: 0;
  border-left: 2px solid var(--ink);
  border-top: 2px solid var(--ink);
}
.audience-card,
.case-card,
.price-card,
.step,
.ecosystem-card,
.card-3d,
.card {
  position: relative;
  display: flex;
  flex-direction: column;
  min-height: 300px;
  padding: 24px;
  border: 0;
  border-right: 2px solid var(--ink);
  border-bottom: 2px solid var(--ink);
  background: var(--paper-2);
  box-shadow: none;
  border-radius: 0;
  overflow: hidden;
}
.audience-card:nth-child(2n),
.case-card:nth-child(2n),
.step:nth-child(2n),
.ecosystem-card:nth-child(2n) {
  background: var(--paper);
}
.audience-card:nth-child(3n),
.ecosystem-card:nth-child(3n) {
  background: var(--acid);
}
.card-index,
.service-no,
.problem-icon,
.ecosystem-card span,
.step span,
.price-top span {
  display: inline-grid;
  place-items: center;
  width: 42px;
  height: 42px;
  margin-bottom: 24px;
  border: 2px solid var(--ink);
  background: var(--ink);
  color: var(--paper);
  font-size: 12px;
  font-weight: 950;
  line-height: 1;
}
.audience-card h3,
.case-card h3,
.price-card h3,
.step h3,
.ecosystem-card h3 {
  font-family: var(--tfac-font-head);
  font-size: clamp(24px, 2.7vw, 40px);
  line-height: 0.98;
  letter-spacing: -0.06em;
  text-transform: uppercase;
  font-weight: 950;
  overflow-wrap: break-word;
  hyphens: auto;
  text-wrap: balance;
}
.audience-card p,
.case-card p,
.price-card li,
.step p,
.ecosystem-card p {
  margin-top: 16px;
  color: #262626;
  font-size: 15px;
  font-weight: 750;
  line-height: 1.42;
}
.audience-card strong {
  margin-top: auto;
  padding-top: 28px;
  color: var(--red);
  font-size: 15px;
  font-weight: 950;
  text-transform: uppercase;
}
.audience-card:after,
.ecosystem-card:after,
.case-card:after {
  content: "";
  position: absolute;
  right: 18px;
  bottom: 18px;
  width: 52px;
  height: 52px;
  border-right: 2px solid var(--ink);
  border-bottom: 2px solid var(--ink);
  opacity: 0.16;
}

.services-list {
  display: grid;
  border-top: 2px solid var(--paper);
}
.service-row {
  display: grid;
  grid-template-columns: 76px minmax(0, 1fr) auto;
  gap: 24px;
  align-items: center;
  padding: 24px 0;
  border-bottom: 2px solid var(--paper);
  background: transparent;
}
.service-no {
  margin: 0;
  background: var(--paper);
  color: var(--ink);
  border-color: var(--paper);
}
.service-main h3 {
  font-family: var(--tfac-font-head);
  font-size: clamp(30px, 3.8vw, 56px);
  line-height: 0.92;
  letter-spacing: -0.07em;
  text-transform: uppercase;
  color: var(--paper);
  text-wrap: balance;
}
.service-main p {
  max-width: 660px;
  margin-top: 12px;
  color: rgba(243, 239, 229, 0.68);
  font-size: 17px;
  font-weight: 750;
}
.service-tag {
  display: inline-flex;
  align-items: center;
  min-height: 42px;
  padding: 0 16px;
  border: 2px solid var(--paper);
  background: var(--acid);
  color: var(--ink);
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.05em;
  white-space: nowrap;
}
.service-row:hover .service-tag {
  background: var(--paper);
  color: var(--ink);
}

.directions-grid,
.manifesto-grid,
.problem-grid,
.form-wrap,
.faq-grid,
.about-grid {
  display: grid;
  grid-template-columns: minmax(0, 0.72fr) minmax(380px, 1fr);
  gap: 50px;
  align-items: start;
}
.directions-copy h2,
.manifesto-left h2 {
  font-size: clamp(46px, 6.1vw, 92px);
}
.directions-copy .lead {
  margin-top: 24px;
}
.directions-sticker {
  width: max-content;
  max-width: 100%;
  margin-top: 36px;
  padding: 18px 22px;
  border: 2px solid var(--ink);
  background: var(--acid);
  font-family: var(--tfac-font-head);
  font-size: clamp(24px, 3.2vw, 42px);
  line-height: 0.94;
  letter-spacing: -0.06em;
  text-transform: uppercase;
  font-weight: 950;
}
.direction-wall {
  display: flex;
  flex-wrap: wrap;
  align-content: center;
  align-items: center;
  gap: 10px;
  min-height: 520px;
  padding: 28px;
  border: 2px solid var(--ink);
  background: var(--ink);
  box-shadow: none;
  border-radius: 0;
}
.direction-chip {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  min-height: 44px;
  padding: 0 18px;
  border: 2px solid var(--paper);
  background: var(--paper);
  color: var(--ink);
  font-size: 15px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.04em;
  transform: none !important;
}
.direction-chip:nth-child(3n) {
  background: var(--acid);
  border-color: var(--acid);
}
.direction-chip:nth-child(4n) {
  background: transparent;
  color: var(--paper);
}
.direction-chip:before {
  content: "/";
  margin-right: 8px;
}
.problem-title-card {
  min-height: 520px;
  background: var(--ink);
  color: var(--paper);
  border: 2px solid var(--ink);
  padding: 30px;
}
.problem-title-card .eyebrow {
  color: var(--acid);
}
.problem-title-card h2 {
  font-family: var(--tfac-font-head);
  font-size: clamp(40px, 5.4vw, 78px);
  line-height: 0.88;
  letter-spacing: -0.07em;
  text-transform: uppercase;
  text-wrap: balance;
}
.problem-title-card p {
  margin-top: 24px;
  color: rgba(243, 239, 229, 0.76);
  font-size: 18px;
  line-height: 1.42;
  font-weight: 800;
}
.problem-list {
  display: grid;
  gap: 0;
  border-top: 2px solid var(--ink);
}
.problem-item {
  display: grid;
  grid-template-columns: 58px 1fr;
  gap: 18px;
  align-items: start;
  padding: 22px 0;
  border-bottom: 2px solid var(--ink);
  background: transparent;
}
.problem-icon {
  margin: 0;
  background: var(--acid);
  color: var(--ink);
}
.problem-item b {
  display: block;
  font-family: var(--tfac-font-head);
  font-size: clamp(21px, 2vw, 32px);
  line-height: 1;
  letter-spacing: -0.05em;
  text-transform: uppercase;
  overflow-wrap: break-word;
  hyphens: auto;
}
.problem-item span {
  display: block;
  margin-top: 8px;
  color: var(--muted);
  font-weight: 800;
}
.manifesto-section {
  overflow: hidden;
}
.manifesto-section:after {
  content: attr(data-watermark);
  position: absolute;
  right: -3vw;
  bottom: 2vw;
  color: rgba(243, 239, 229, 0.06);
  font-family: var(--tfac-font-head);
  font-size: 9vw;
  font-weight: 950;
  line-height: 0.8;
  letter-spacing: -0.08em;
  text-transform: uppercase;
  pointer-events: none;
}
.manifesto-questions {
  display: grid;
  grid-template-columns: 1fr 1fr;
  gap: 0;
  border-left: 2px solid var(--paper);
  border-top: 2px solid var(--paper);
}
.question-bubble {
  min-height: 180px;
  padding: 24px;
  border: 0;
  border-right: 2px solid var(--paper);
  border-bottom: 2px solid var(--paper);
  background: transparent;
  color: var(--paper);
  font-family: var(--tfac-font-head);
  font-size: clamp(22px, 2.6vw, 40px);
  line-height: 0.96;
  letter-spacing: -0.05em;
  text-transform: uppercase;
  font-weight: 950;
  overflow-wrap: break-word;
  hyphens: auto;
  text-wrap: balance;
}
.question-bubble:nth-child(2),
.question-bubble:nth-child(3) {
  background: var(--acid);
  color: var(--ink);
}

.case-grid,
.price-grid,
.steps {
  grid-template-columns: repeat(3, 1fr);
}
.case-label {
  display: inline-flex;
  align-items: center;
  width: max-content;
  margin-bottom: 22px;
  padding: 8px 12px;
  background: var(--ink);
  color: var(--paper);
  font-size: 11px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.08em;
}
.case-metric {
  margin: 22px 0 0;
  color: var(--red);
  font-family: var(--tfac-font-head);
  font-size: clamp(42px, 5vw, 74px);
  line-height: 0.86;
  letter-spacing: -0.08em;
  text-transform: uppercase;
  font-weight: 950;
}
.cta-row {
  margin-top: 28px;
}
.price-card {
  min-height: 410px;
}
.price-card.featured {
  background: var(--acid);
}
.price-top {
  display: flex;
  gap: 18px;
  align-items: flex-start;
}
.price {
  margin: 26px 0;
  color: var(--red);
  font-family: var(--tfac-font-head);
  font-size: clamp(38px, 4vw, 62px);
  line-height: 0.86;
  letter-spacing: -0.08em;
  text-transform: uppercase;
  font-weight: 950;
}
.price-card ul {
  display: grid;
  gap: 12px;
  margin-top: auto;
  padding: 0;
  list-style: none;
}
.price-card li:before {
  content: "/";
  margin-right: 8px;
  font-weight: 950;
}
.price-card .btn {
  margin-top: 24px;
  width: 100%;
}
.steps {
  grid-template-columns: repeat(4, 1fr);
}
.faq-list {
  display: grid;
  gap: 0;
  border-top: 2px solid var(--ink);
}
.faq-item {
  border: 0;
  border-bottom: 2px solid var(--ink);
  background: transparent;
  padding: 0;
}
.faq-item summary {
  cursor: pointer;
  list-style: none;
  padding: 22px 0;
  font-family: var(--tfac-font-head);
  font-size: clamp(24px, 2.5vw, 40px);
  line-height: 0.95;
  letter-spacing: -0.06em;
  text-transform: uppercase;
  font-weight: 950;
}
.faq-item summary::-webkit-details-marker {
  display: none;
}
.faq-item summary:before {
  content: "/";
  display: inline-block;
  margin-right: 12px;
  color: var(--red);
}
.faq-item p {
  padding: 0 0 22px 34px;
  color: var(--muted);
  font-weight: 750;
}
.ecosystem-section {
  background: var(--paper-2);
}
.ecosystem-grid {
  grid-template-columns: repeat(4, 1fr);
}
.ecosystem-card {
  min-height: 270px;
}

.contact-section {
  background: var(--ink);
  color: var(--paper);
}
.contact-box,
.contact-card {
  border: 2px solid var(--paper);
  background: transparent;
  color: var(--paper);
  box-shadow: none;
  border-radius: 0;
  padding: 26px;
}
.contact-box h3 {
  font-family: var(--tfac-font-head);
  font-size: clamp(30px, 3.2vw, 54px);
  line-height: 0.9;
  letter-spacing: -0.07em;
  text-transform: uppercase;
}
.contact-box p {
  margin-top: 16px;
  color: rgba(243, 239, 229, 0.72);
  font-weight: 750;
}
.contact-details strong {
  color: var(--acid);
}
.lead-form {
  display: grid;
  gap: 16px;
}
.field-grid {
  display: grid;
  grid-template-columns: 1fr 1fr;
  gap: 16px;
}
.form-field {
  display: grid;
  gap: 8px;
}
.form-field label,
.consent-field {
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.08em;
  color: rgba(243, 239, 229, 0.78);
}
.form-field input,
.form-field select,
.form-field textarea {
  width: 100%;
  min-height: 50px;
  border: 2px solid var(--paper);
  background: var(--paper);
  color: var(--ink);
  padding: 12px 14px;
  outline: 0;
  border-radius: 0;
  font-size: 16px;
  font-weight: 750;
}
.form-field textarea {
  min-height: 130px;
  resize: vertical;
}
.form-field input:focus,
.form-field select:focus,
.form-field textarea:focus {
  background: var(--white);
  border-color: var(--acid);
}
.consent-field {
  display: grid;
  grid-template-columns: 20px 1fr;
  gap: 12px;
  align-items: start;
  text-transform: none;
  letter-spacing: 0;
  line-height: 1.35;
}
.consent-field input {
  accent-color: var(--acid);
}
.consent-field a {
  color: var(--acid);
  text-decoration: underline;
}
.hp-field {
  display: none !important;
}
.form-message {
  padding: 14px 16px;
  border: 2px solid var(--paper);
  font-weight: 900;
}
.form-message.ok {
  background: var(--acid);
  color: var(--ink);
  border-color: var(--acid);
}
.form-message.bad {
  background: var(--red);
  color: var(--paper);
  border-color: var(--red);
}

.site-footer {
  background: var(--ink);
  color: var(--paper);
  padding: 54px 0 26px;
}
.footer-grid {
  display: grid;
  grid-template-columns: minmax(0, 1.2fr) repeat(2, minmax(180px, 0.4fr));
  gap: 40px;
  padding-bottom: 40px;
  border-bottom: 2px solid rgba(243, 239, 229, 0.24);
}
.site-footer .brand-mark {
  background: var(--acid);
  color: var(--ink);
  border-color: var(--acid);
}
.site-footer .brand-sub,
.footer-about,
.footer-links li,
.footer-links a,
.footer-bottom {
  color: rgba(243, 239, 229, 0.68);
}
.footer-about {
  max-width: 520px;
  margin-top: 22px;
  font-weight: 750;
}
.footer-heading {
  margin-bottom: 14px;
  font-family: var(--tfac-font-head);
  font-size: 20px;
  line-height: 0.9;
  letter-spacing: -0.05em;
  text-transform: uppercase;
}
.footer-links {
  display: grid;
  gap: 9px;
  padding: 0;
  list-style: none;
}
.footer-links a:hover {
  color: var(--acid);
}
.footer-bottom {
  display: flex;
  justify-content: space-between;
  gap: 16px;
  padding-top: 22px;
  font-size: 12px;
  font-weight: 900;
  text-transform: uppercase;
  letter-spacing: 0.08em;
}
.floating-contact {
  position: fixed;
  right: 18px;
  bottom: 18px;
  z-index: 999;
  display: grid;
  gap: 8px;
}
.floating-contact a {
  display: grid;
  place-items: center;
  width: 48px;
  height: 48px;
  border: 2px solid var(--ink);
  background: var(--acid);
  color: var(--ink);
  font-weight: 950;
}
.cookie-banner {
  position: fixed;
  left: 18px;
  bottom: 18px;
  z-index: 1001;
  display: none;
  max-width: 480px;
  padding: 18px;
  border: 2px solid var(--ink);
  background: var(--paper-2);
  color: var(--ink);
}
.cookie-banner.show {
  display: block;
}
.cookie-banner p {
  font-weight: 750;
}
.cookie-actions {
  display: flex;
  gap: 8px;
  margin-top: 12px;
}
.cookie-actions button {
  min-height: 38px;
  border: 2px solid var(--ink);
  background: var(--ink);
  color: var(--paper);
  font-weight: 950;
  text-transform: uppercase;
}
.cookie-actions button.ghost {
  background: transparent;
  color: var(--ink);
}

.content-area,
.page-content {
  padding: 70px 0;
}
.page-content h1,
.content-area h1 {
  font-family: var(--tfac-font-head);
  font-size: clamp(42px, 6vw, 92px);
  line-height: 0.88;
  letter-spacing: -0.08em;
  text-transform: uppercase;
  text-wrap: balance;
}
.page-lead {
  margin-top: 18px;
  max-width: 780px;
}
.cards {
  display: grid;
  grid-template-columns: repeat(3, 1fr);
  gap: 0;
  margin-top: 34px;
  border-left: 2px solid var(--ink);
  border-top: 2px solid var(--ink);
}
.article-card {
  min-height: 250px;
  padding: 24px;
  border-right: 2px solid var(--ink);
  border-bottom: 2px solid var(--ink);
  background: var(--paper-2);
}
.article-card h2,
.article-card h3 {
  font-family: var(--tfac-font-head);
  font-size: 28px;
  line-height: 1;
  letter-spacing: -0.05em;
  text-transform: uppercase;
  overflow-wrap: break-word;
  hyphens: auto;
}
.post-date,
.muted {
  color: var(--muted);
  font-size: 12px;
  font-weight: 950;
  text-transform: uppercase;
  letter-spacing: 0.08em;
}
.search-form {
  display: flex;
  gap: 0;
  margin-top: 26px;
}
.search-form input {
  min-height: 50px;
  border: 2px solid var(--ink);
  background: var(--paper-2);
  padding: 12px;
  flex: 1;
}
.search-form button {
  border: 2px solid var(--ink);
  border-left: 0;
  background: var(--acid);
  font-weight: 950;
  text-transform: uppercase;
  padding: 0 18px;
}

@media (max-width: 1180px) {
  .container {
    width: min(var(--container), calc(100% - 36px));
  }
  .main-nav a {
    padding-inline: 9px;
    font-size: 10px;
  }
  .header-cta {
    padding-inline: 12px;
  }
  .hero-grid {
    grid-template-columns: 1fr;
  }
  .impact-board {
    max-width: 760px;
  }
  .ecosystem-grid,
  .audience-grid,
  .steps {
    grid-template-columns: repeat(2, 1fr);
  }
  .service-row {
    grid-template-columns: 58px 1fr;
  }
  .service-tag {
    grid-column: 2;
  }
  .section-head,
  .intro-grid,
  .directions-grid,
  .manifesto-grid,
  .problem-grid,
  .form-wrap,
  .faq-grid,
  .about-grid {
    grid-template-columns: 1fr;
  }
}
@media (max-width: 1080px) {
  .menu-toggle {
    display: grid;
    flex: 0 0 46px;
  }
  .main-nav {
    position: fixed;
    display: none;
    flex-direction: column;
    align-items: stretch;
    left: 18px;
    right: 18px;
    top: calc(76px + env(safe-area-inset-top));
    margin: 0;
    background: var(--paper-2);
    border: 2px solid var(--ink);
    z-index: 1001;
  }
  .main-nav.open {
    display: flex;
  }
  .main-nav a {
    min-height: 52px;
    border-right: 0;
    border-bottom: 2px solid var(--ink);
    font-size: 13px;
  }
  .main-nav a:last-child {
    border-bottom: 0;
  }
  .header-cta {
    display: none;
  }
  .header-inner {
    gap: 10px;
  }
  .lang-switch {
    margin-left: auto;
  }
}
@media (max-width: 760px) {
  .container {
    width: calc(100% - 28px);
  }
  .header-inner {
    height: 70px;
  }
  .brand-name {
    font-size: 15px;
  }
  .brand-mark {
    height: 40px;
    min-width: 56px;
  }
  .main-nav {
    top: calc(70px + env(safe-area-inset-top));
    left: 14px;
    right: 14px;
  }
  .agency-hero {
    padding: 46px 0;
  }
  .hero-display-top {
    font-size: clamp(42px, 14vw, 72px);
  }
  .hero-display-bottom {
    font-size: clamp(40px, 13vw, 68px);
  }
  .hero-badges {
    width: 100%;
    display: grid;
    grid-template-columns: 1fr 1fr;
  }
  .hero-badges span {
    border-bottom: 2px solid var(--paper);
    font-size: 10px;
  }
  .hero-badges span:nth-child(2n) {
    border-right: 0;
  }
  .hero-badges span:nth-last-child(-n + 2) {
    border-bottom: 0;
  }
  .hero-actions {
    display: grid;
    grid-template-columns: 1fr;
  }
  .hero-actions .btn {
    width: 100%;
  }
  .impact-board,
  .impact-mini-grid,
  .intro-proof,
  .field-grid,
  .manifesto-questions {
    grid-template-columns: 1fr;
  }
  .mini-stat,
  .proof-cell {
    border-right: 0;
    border-bottom: 2px solid var(--ink);
  }
  .mini-stat:last-child,
  .proof-cell:nth-child(2) {
    border-bottom: 0;
  }
  .section {
    padding: 54px 0;
  }
  .section h2,
  .directions-copy h2,
  .manifesto-left h2 {
    font-size: clamp(36px, 11vw, 56px) !important;
    line-height: 0.9;
  }
  .lead {
    font-size: 17px;
  }
  .section-head {
    gap: 20px;
    margin-bottom: 28px;
  }
  .audience-grid,
  .case-grid,
  .price-grid,
  .steps,
  .ecosystem-grid,
  .cards {
    grid-template-columns: 1fr;
  }
  .audience-card,
  .case-card,
  .price-card,
  .step,
  .ecosystem-card {
    min-height: 230px;
  }
  .service-row {
    grid-template-columns: 46px 1fr;
    gap: 16px;
  }
  .service-main h3 {
    font-size: clamp(26px, 8.8vw, 40px);
  }
  .service-tag {
    grid-column: 1/-1;
    width: 100%;
    justify-content: center;
  }
  .direction-wall {
    min-height: auto;
    padding: 18px;
  }
  .direction-chip {
    width: 100%;
    justify-content: flex-start;
  }
  .problem-title-card {
    min-height: auto;
  }
  .problem-item {
    grid-template-columns: 46px 1fr;
  }
  .question-bubble {
    min-height: 128px;
  }
  .footer-grid {
    grid-template-columns: 1fr;
  }
  .footer-bottom {
    display: grid;
  }
  .cookie-banner {
    left: 12px;
    right: 12px;
    bottom: calc(12px + env(safe-area-inset-bottom));
  }
  .floating-contact {
    bottom: calc(12px + env(safe-area-inset-bottom));
  }
}
@media (max-width: 420px) {
  .container {
    width: calc(100% - 22px);
  }
  .lang-switch a {
    min-width: 30px;
    height: 34px;
    font-size: 9px;
  }
  .menu-toggle {
    width: 42px;
    height: 42px;
  }
  .btn {
    min-height: 48px;
    font-size: 11px;
  }
  .hero-display-top {
    font-size: clamp(36px, 14vw, 58px);
  }
  .hero-display-bottom {
    font-size: clamp(34px, 13vw, 54px);
  }
  .section {
    padding: 46px 0;
  }
  .audience-card,
  .case-card,
  .price-card,
  .step,
  .ecosystem-card,
  .contact-card,
  .contact-box {
    padding: 20px;
  }
}
@media (prefers-reduced-motion: reduce) {
  *,
  *:before,
  *:after {
    animation-duration: 0.01ms !important;
    animation-iteration-count: 1 !important;
    scroll-behavior: auto !important;
  }
  .ticker-track {
    animation: none;
  }
}
@media print {
  .site-header,
  .floating-contact,
  .cookie-banner,
  .menu-toggle,
  .ticker-wrap {
    display: none !important;
  }
  body {
    background: #f3efe5;
    color: #000;
  }
  .section,
  .agency-hero {
    background: #f3efe5 !important;
    color: #000 !important;
    border: 0 !important;
    padding: 24px 0;
  }
  .card-3d,
  .impact-card,
  .audience-card,
  .case-card,
  .price-card,
  .step,
  .faq-item,
  .contact-card {
    box-shadow: none !important;
    border: 1px solid #000 !important;
  }
}

/* 1.9.5 paper color correction layer
   Approved logo, typefaces, favicon and avatar assets are not modified. */

/* Header and approved uploaded logo sizing */
.header-inner {
  height: 88px;
}
.brand {
  flex: 0 1 auto;
  max-width: 300px;
}
.brand-logo {
  display: inline-flex;
  align-items: center;
  justify-content: flex-start;
  width: auto;
  height: auto;
  max-width: 280px;
  max-height: 72px;
  min-width: 0;
}
.brand-logo img {
  display: block;
  width: auto;
  height: auto;
  max-width: 280px;
  max-height: 72px;
  object-fit: contain;
}
.brand-fallback {
  display: inline-block;
  font-family: var(--tfac-font-head);
  font-size: 22px;
  font-weight: 950;
  line-height: 1;
  letter-spacing: -0.055em;
  text-transform: lowercase;
  white-space: nowrap;
}
.site-footer .brand-logo,
.site-footer .brand-logo img {
  max-width: 300px;
  max-height: 82px;
}
.site-footer .brand-fallback {
  color: var(--white);
}

/* Brand palette and accessible controls */
.skip-link:focus,
.main-nav a:hover,
.header-cta,
.btn-yellow,
.ticker-wrap,
.tick,
.service-tag,
.directions-sticker,
.direction-chip:nth-child(3n),
.problem-icon,
.question-bubble:nth-child(2),
.question-bubble:nth-child(3),
.price-card.featured,
.form-message.ok,
.floating-contact a,
.search-form button,
.proof-note {
  background: var(--acid);
  color: var(--white);
}
.header-cta,
.btn-yellow,
.service-tag,
.directions-sticker,
.problem-icon,
.floating-contact a,
.search-form button {
  border-color: var(--ink);
}
.header-cta:hover,
.btn-yellow:hover,
.floating-contact a:hover,
.search-form button:hover {
  background: var(--ink);
  color: var(--white);
}
.main-nav a:hover {
  color: var(--white);
}
::selection {
  background: var(--acid);
  color: var(--white);
}

/* Dark sections: light text; burgundy is used as a fill, not as small text */
.agency-hero,
.section-blue,
.contact-section,
.site-footer,
.manifesto-section,
.problem-title-card,
.direction-wall {
  background: var(--dark);
  color: var(--white);
}
.agency-hero h1,
.agency-hero h2,
.agency-hero h3,
.section-blue h1,
.section-blue h2,
.section-blue h3,
.contact-section h1,
.contact-section h2,
.contact-section h3,
.site-footer h1,
.site-footer h2,
.site-footer h3,
.problem-title-card h2,
.service-main h3 {
  color: var(--white);
}
.agency-hero p,
.agency-hero li,
.agency-hero .lead,
.agency-hero .hero-note,
.section-blue p,
.section-blue li,
.section-blue .lead,
.section-blue .on-dark,
.contact-section p,
.contact-section label,
.contact-section .consent-field,
.site-footer p,
.site-footer li,
.site-footer a,
.site-footer .footer-bottom,
.problem-title-card p,
.service-main p,
.simple-list li {
  color: rgba(243, 239, 229, 0.82);
}
.agency-hero .eyebrow,
.section-blue .eyebrow,
.contact-section .eyebrow,
.problem-title-card .eyebrow,
.agency-hero .hero-display-bottom,
.contact-details strong,
.impact-kicker {
  color: var(--white);
}

/* Light sections and cards */
.section-cream,
.section-white,
.audience-card,
.case-card,
.price-card,
.step,
.ecosystem-card,
.article-card,
.cookie-banner {
  color: var(--ink);
}
.section-cream h1,
.section-cream h2,
.section-cream h3,
.section-white h1,
.section-white h2,
.section-white h3,
.audience-card h3,
.case-card h3,
.price-card h3,
.step h3,
.ecosystem-card h3,
.article-card h2,
.article-card h3,
.faq-item summary,
.problem-item b {
  color: var(--ink);
}
.section-cream p,
.section-cream li,
.section-white p,
.section-white li,
.audience-card p,
.case-card p,
.price-card p,
.price-card li,
.step p,
.ecosystem-card p,
.article-card p,
.faq-item p,
.problem-item span {
  color: var(--ink);
}

/* Burgundy cards use the approved paper tone for light text */
.audience-card:nth-child(3n),
.ecosystem-card:nth-child(3n),
.price-card.featured,
.question-bubble:nth-child(2),
.question-bubble:nth-child(3) {
  color: var(--white);
}
.audience-card:nth-child(3n) h3,
.audience-card:nth-child(3n) p,
.audience-card:nth-child(3n) strong,
.ecosystem-card:nth-child(3n) h3,
.ecosystem-card:nth-child(3n) p,
.price-card.featured h3,
.price-card.featured p,
.price-card.featured li,
.price-card.featured .price,
.price-card.featured .price-top span,
.question-bubble:nth-child(2),
.question-bubble:nth-child(3) {
  color: var(--white);
}

/* Price buttons: cards one and three use a light button with dark text */
.price-card:not(.featured) .btn,
.price-card:not(.featured) .btn-ghost {
  background: var(--paper);
  color: var(--ink);
  border-color: var(--ink);
}
.price-card:not(.featured) .btn:hover,
.price-card:not(.featured) .btn-ghost:hover {
  background: var(--ink);
  color: var(--white);
  border-color: var(--ink);
}
.price-card.featured .btn {
  background: var(--white);
  color: var(--ink);
  border-color: var(--ink);
}
.price-card.featured .btn:hover {
  background: var(--ink);
  color: var(--white);
}
.section-blue .price-card:not(.featured) h3,
.section-blue .price-card:not(.featured) p,
.section-blue .price-card:not(.featured) li,
.section-blue .price-card:not(.featured) .price-top span {
  color: var(--ink);
}
.section-blue .price-card:not(.featured) .price {
  color: var(--acid);
}

/* Hero: one stable full-width layout */
.agency-hero {
  padding: 48px 0 44px;
  min-height: auto;
}
.hero-grid {
  grid-template-columns: minmax(0, 1fr);
  gap: 0;
  align-items: start;
}
.hero-copy {
  width: 100%;
  max-width: none;
}
.hero-display {
  width: 100%;
  max-width: 1120px;
  margin-bottom: 20px;
}
.hero-display-top {
  font-size: clamp(58px, 7.2vw, 104px);
  line-height: 0.86;
  letter-spacing: -0.075em;
}
.hero-display-bottom {
  margin-top: 8px;
  font-size: clamp(54px, 6.7vw, 96px);
  line-height: 0.86;
  letter-spacing: -0.075em;
}
.hero-lead {
  max-width: 920px;
  margin-top: 0;
}
.hero-actions {
  margin-top: 22px;
}
.hero-note {
  max-width: 920px;
  margin-top: 18px;
}
.impact-board,
.intro-proof {
  display: none;
}

/* Full-width introductory copy without oversized stat blocks */
.intro-section {
  padding-top: 58px;
}
.intro-grid {
  display: grid;
  grid-template-columns: minmax(0, 1fr);
  gap: 0;
  width: min(var(--container), calc(100% - 48px));
  max-width: none;
  margin: 0 auto 36px;
}
.intro-grid > div {
  width: 100%;
  max-width: none;
}
.intro-grid h2 {
  max-width: 1040px;
}
.intro-grid .lead {
  max-width: 1000px;
  margin-top: 24px;
}
.section-head .lead {
  max-width: 680px;
}
.directions-copy .lead,
.about-copy .lead {
  max-width: 900px;
}
.contact-copy .lead {
  max-width: 760px;
}

/* Consistent heading scale */
.section h2,
.directions-copy h2,
.manifesto-left h2 {
  font-size: clamp(34px, 4.6vw, 68px);
  line-height: 0.9;
  letter-spacing: -0.07em;
}
.problem-title-card h2 {
  font-size: clamp(32px, 4vw, 56px);
  line-height: 0.9;
}
.about-copy h2,
.faq-grid h2 {
  font-size: clamp(34px, 4.2vw, 62px);
  line-height: 0.9;
}
.contact-copy h2 {
  font-size: clamp(32px, 3.8vw, 54px);
  line-height: 0.92;
}
.contact-box h3 {
  font-size: clamp(20px, 2vw, 30px);
  line-height: 0.96;
}
.faq-item summary {
  font-size: clamp(21px, 2vw, 32px);
  line-height: 1;
}

/* Cards and metrics */
.audience-card,
.case-card,
.price-card,
.step,
.ecosystem-card {
  min-height: 280px;
}
.case-metric,
.price {
  color: var(--acid);
}
.card-index,
.ecosystem-card span,
.step span,
.price-top span {
  color: var(--white);
}
.service-no {
  color: var(--ink);
}

/* Contact form */
.contact-card,
.contact-box {
  border-color: var(--white);
}
.form-field label,
.consent-field {
  color: rgba(243, 239, 229, 0.86);
}
.form-field input,
.form-field select,
.form-field textarea {
  background: var(--paper);
  color: var(--ink);
  border-color: var(--white);
}
.form-field input:focus,
.form-field select:focus,
.form-field textarea:focus {
  background: var(--white);
  border-color: var(--acid);
}
.consent-field a {
  color: var(--white);
}
.form-message.ok {
  border-color: var(--acid);
}
.form-message.bad {
  background: var(--dark);
  color: var(--white);
  border-color: var(--white);
}

/* Footer */
.site-footer .footer-about,
.site-footer .footer-links li,
.site-footer .footer-links a,
.site-footer .footer-bottom {
  color: rgba(243, 239, 229, 0.72);
}
.site-footer .footer-links a:hover {
  color: var(--white);
  text-decoration: underline;
}

@media (max-width: 1180px) {
  .brand-logo,
  .brand-logo img {
    max-width: 235px;
    max-height: 66px;
  }
  .hero-display-top {
    font-size: clamp(44px, 10vw, 78px);
  }
  .hero-display-bottom {
    font-size: clamp(42px, 9.5vw, 72px);
  }
  .intro-grid {
    width: calc(100% - 36px);
  }
}

@media (max-width: 1080px) {
  .header-inner {
    height: 78px;
  }
  .main-nav {
    top: calc(78px + env(safe-area-inset-top));
  }
}

@media (max-width: 760px) {
  .header-inner {
    height: 74px;
  }
  .brand {
    max-width: 190px;
  }
  .brand-logo,
  .brand-logo img {
    max-width: 190px;
    max-height: 58px;
  }
  .brand-fallback {
    font-size: 18px;
  }
  .site-footer .brand-logo,
  .site-footer .brand-logo img {
    max-width: 230px;
    max-height: 68px;
  }
  .main-nav {
    top: calc(74px + env(safe-area-inset-top));
  }
  .agency-hero {
    padding: 32px 0 30px;
  }
  .hero-display-top {
    font-size: clamp(36px, 13vw, 56px);
  }
  .hero-display-bottom {
    font-size: clamp(34px, 12vw, 52px);
  }
  .intro-section {
    padding-top: 44px;
  }
  .intro-grid {
    width: calc(100% - 28px);
    margin-bottom: 28px;
  }
  .section {
    padding: 52px 0;
  }
  .section h2,
  .directions-copy h2,
  .manifesto-left h2,
  .problem-title-card h2,
  .about-copy h2,
  .faq-grid h2,
  .contact-copy h2 {
    font-size: clamp(30px, 9vw, 44px) !important;
    line-height: 0.94 !important;
  }
  .faq-item summary {
    font-size: clamp(20px, 6.2vw, 28px);
  }
  .audience-card,
  .case-card,
  .price-card,
  .step,
  .ecosystem-card {
    min-height: 0;
  }
  .field-grid {
    grid-template-columns: 1fr;
  }
}

@media (max-width: 420px) {
  .brand {
    max-width: 160px;
  }
  .brand-logo,
  .brand-logo img {
    max-width: 160px;
    max-height: 52px;
  }
  .brand-fallback {
    font-size: 16px;
  }
}

/* 1.9.9 — richer “Why trust us?” composition.
   Isolated to #about only; logo, fonts, favicon, avatar and other sections stay untouched. */
#about {
  overflow: hidden;
  background: var(--paper);
}

#about .about-grid {
  display: grid;
  grid-template-columns: minmax(0, 0.88fr) minmax(460px, 1.08fr);
  gap: clamp(54px, 6vw, 92px);
  align-items: center;
}

#about .about-copy {
  position: relative;
  z-index: 2;
}

#about .about-copy h2 {
  max-width: 720px;
  margin: 0;
  font-size: clamp(46px, 5.4vw, 78px);
  line-height: 0.86;
  letter-spacing: -0.075em;
  text-wrap: balance;
}

#about .about-copy h2::after {
  content: "";
  display: block;
  width: clamp(86px, 10vw, 150px);
  height: 3px;
  margin-top: 24px;
  background: linear-gradient(90deg, var(--acid) 0 58%, rgba(167, 40, 77, 0.18) 58% 100%);
}

#about .about-copy .lead {
  max-width: 760px;
  margin-top: 22px;
  color: var(--ink);
  font-size: clamp(17px, 1.45vw, 21px);
  font-weight: 730;
  line-height: 1.5;
  letter-spacing: -0.015em;
}

#about .about-proof {
  position: relative;
  isolation: isolate;
  padding: clamp(34px, 4vw, 54px) clamp(26px, 3.5vw, 48px);
  border-radius: 58px 8px 58px 58px;
  background:
    linear-gradient(145deg, rgba(167, 40, 77, 0.09), rgba(167, 40, 77, 0.025));
}

#about .about-proof::before {
  content: "";
  position: absolute;
  z-index: -2;
  inset: -24px 22px 76px -24px;
  border: 2px solid var(--acid);
  border-radius: 58px 8px 58px 58px;
  opacity: 0.78;
  pointer-events: none;
}

#about .about-proof::after {
  content: "";
  position: absolute;
  z-index: -1;
  top: -52px;
  left: -78px;
  width: 190px;
  height: 140px;
  background-image: radial-gradient(circle, rgba(167, 40, 77, 0.68) 1.5px, transparent 1.7px);
  background-size: 14px 14px;
  opacity: 0.55;
  pointer-events: none;
}

#about .about-facts {
  counter-reset: about-proof;
  position: relative;
  display: grid;
  gap: 16px;
  width: 100%;
  min-height: 0;
  margin: 0;
  padding: 0;
  list-style: none;
  background: transparent;
  border: 0;
  box-shadow: none;
  overflow: visible;
}

#about .about-facts::after {
  content: "";
  position: absolute;
  z-index: -1;
  right: -60px;
  bottom: -54px;
  width: 180px;
  height: 132px;
  border-radius: 38px;
  background:
    repeating-linear-gradient(
      135deg,
      transparent 0 10px,
      rgba(167, 40, 77, 0.42) 10px 12px
    );
  opacity: 0.58;
  pointer-events: none;
}

#about .about-facts li {
  counter-increment: about-proof;
  position: relative;
  display: grid;
  grid-template-columns: 60px minmax(0, 1fr);
  gap: 22px;
  align-items: center;
  min-width: 0;
  min-height: 112px;
  margin: 0;
  padding: 24px 68px 24px 24px;
  list-style: none;
  border: 1px solid rgba(45, 45, 45, 0.11);
  border-radius: 22px;
  background: var(--paper);
  box-shadow:
    0 20px 46px rgba(45, 45, 45, 0.12),
    0 4px 10px rgba(45, 45, 45, 0.055);
  transition: transform 180ms ease, box-shadow 180ms ease, border-color 180ms ease;
}

#about .about-facts li:nth-child(2) {
  transform: translateX(22px);
}

#about .about-facts li:nth-child(3) {
  transform: translateX(8px);
}

#about .about-facts li::before {
  content: "";
  position: absolute;
  left: 94px;
  top: 22px;
  bottom: 22px;
  width: 1px;
  background: rgba(45, 45, 45, 0.14);
}

#about .about-facts li::after {
  content: "0" counter(about-proof);
  position: absolute;
  top: 16px;
  right: 18px;
  color: var(--acid);
  font-size: 10px;
  font-weight: 950;
  line-height: 1;
  letter-spacing: 0.14em;
  opacity: 0.62;
}

#about .about-facts li:hover {
  transform: translateY(-4px);
  border-color: rgba(167, 40, 77, 0.36);
  box-shadow:
    0 26px 54px rgba(45, 45, 45, 0.14),
    0 7px 14px rgba(45, 45, 45, 0.06);
}

#about .about-facts li:nth-child(2):hover {
  transform: translate(22px, -4px);
}

#about .about-facts li:nth-child(3):hover {
  transform: translate(8px, -4px);
}

#about .about-facts li::marker {
  content: "";
}

#about .about-facts .tick {
  display: grid;
  place-items: center;
  width: 56px;
  height: 56px;
  margin: 0;
  border-radius: 50%;
  background: var(--acid);
  color: var(--paper);
  font-size: 31px;
  font-weight: 950;
  line-height: 1;
  box-shadow: inset 0 -5px 0 rgba(45, 45, 45, 0.11);
}

#about .about-facts li > span:last-child {
  min-width: 0;
  padding-left: 16px;
  color: var(--ink);
  font-family: var(--tfac-font-body);
  font-size: clamp(17px, 1.65vw, 22px);
  font-weight: 850;
  line-height: 1.28;
  letter-spacing: -0.025em;
  overflow-wrap: anywhere;
}

#about .about-facts li:first-child > span:last-child {
  font-weight: 950;
}

@media (max-width: 1180px) {
  #about .about-grid {
    grid-template-columns: 1fr;
    gap: 54px;
  }

  #about .about-copy h2,
  #about .about-copy .lead {
    max-width: 900px;
  }

  #about .about-proof {
    width: min(860px, 100%);
    margin-inline: auto;
  }
}

@media (max-width: 760px) {
  #about .about-grid {
    gap: 36px;
  }

  #about .about-copy h2 {
    font-size: clamp(36px, 11.5vw, 52px) !important;
    line-height: 0.9 !important;
  }

  #about .about-copy h2::after {
    margin-top: 18px;
  }

  #about .about-copy .lead {
    margin-top: 18px;
    font-size: 16px;
    line-height: 1.48;
  }

  #about .about-proof {
    padding: 26px 18px 28px;
    border-radius: 34px 6px 34px 34px;
  }

  #about .about-proof::before {
    inset: -14px 12px 54px -12px;
    border-radius: 34px 6px 34px 34px;
  }

  #about .about-proof::after {
    top: -36px;
    left: -30px;
    width: 120px;
    height: 92px;
    background-size: 11px 11px;
  }

  #about .about-facts {
    gap: 12px;
  }

  #about .about-facts::after {
    right: -22px;
    bottom: -34px;
    width: 110px;
    height: 86px;
    border-radius: 24px;
  }

  #about .about-facts li,
  #about .about-facts li:nth-child(2),
  #about .about-facts li:nth-child(3) {
    grid-template-columns: 46px minmax(0, 1fr);
    gap: 14px;
    min-height: 0;
    padding: 19px 42px 19px 18px;
    border-radius: 16px;
    transform: none;
  }

  #about .about-facts li:hover,
  #about .about-facts li:nth-child(2):hover,
  #about .about-facts li:nth-child(3):hover {
    transform: none;
  }

  #about .about-facts li::before {
    left: 76px;
    top: 17px;
    bottom: 17px;
  }

  #about .about-facts li::after {
    top: 13px;
    right: 12px;
    font-size: 9px;
  }

  #about .about-facts .tick {
    width: 44px;
    height: 44px;
    font-size: 25px;
  }

  #about .about-facts li > span:last-child {
    padding-left: 10px;
    font-size: 15px;
    line-height: 1.32;
  }
}

@media (prefers-reduced-motion: reduce) {
  #about .about-facts li {
    transition: none;
  }
}

/* 1.10.1 — editorial “Trusted by” grid.
   A compact full-width proof section; isolated to #trusted. */
#trusted {
  position: relative;
  overflow: hidden;
  background: var(--dark);
  color: var(--paper);
  border-top: 1px solid rgba(243, 239, 229, 0.18);
  border-bottom: 1px solid rgba(243, 239, 229, 0.18);
}

#trusted::before {
  content: "";
  position: absolute;
  top: -190px;
  right: -110px;
  width: 430px;
  height: 430px;
  border: 1px solid rgba(167, 40, 77, 0.5);
  border-radius: 50%;
  pointer-events: none;
}

#trusted::after {
  content: "";
  position: absolute;
  left: -45px;
  bottom: -48px;
  width: 190px;
  height: 150px;
  opacity: 0.36;
  background-image: radial-gradient(circle, rgba(243, 239, 229, 0.68) 1.3px, transparent 1.6px);
  background-size: 15px 15px;
  pointer-events: none;
}

#trusted .trusted-container {
  position: relative;
  z-index: 2;
}

#trusted .trusted-head {
  display: grid;
  grid-template-columns: minmax(0, 0.92fr) minmax(320px, 0.72fr);
  gap: clamp(36px, 7vw, 118px);
  align-items: end;
  margin-bottom: clamp(42px, 5vw, 72px);
}

#trusted .eyebrow {
  color: var(--acid);
}

#trusted .trusted-heading h2 {
  max-width: 760px;
  margin: 0;
  color: var(--paper);
  font-size: clamp(46px, 5.4vw, 76px);
  line-height: 0.84;
  letter-spacing: -0.075em;
  text-wrap: balance;
}

#trusted .trusted-intro {
  display: grid;
  gap: 22px;
  padding-bottom: 4px;
}

#trusted .trusted-intro .lead {
  max-width: 620px;
  margin: 0;
  color: var(--paper);
  font-size: clamp(17px, 1.35vw, 21px);
  line-height: 1.5;
  font-weight: 650;
  opacity: 0.86;
}

#trusted .trusted-meta {
  display: inline-flex;
  align-items: center;
  width: fit-content;
  min-height: 34px;
  padding: 7px 12px;
  border: 1px solid rgba(243, 239, 229, 0.25);
  border-radius: 999px;
  color: var(--paper);
  font-size: 11px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.13em;
  text-transform: uppercase;
}

#trusted .trusted-grid {
  display: grid;
  grid-template-columns: repeat(4, minmax(0, 1fr));
  border-top: 1px solid rgba(243, 239, 229, 0.22);
  border-left: 1px solid rgba(243, 239, 229, 0.22);
}

#trusted .trusted-card {
  position: relative;
  display: flex;
  flex-direction: column;
  justify-content: space-between;
  min-width: 0;
  min-height: clamp(128px, 12vw, 176px);
  padding: clamp(20px, 2.1vw, 30px);
  overflow: hidden;
  border-right: 1px solid rgba(243, 239, 229, 0.22);
  border-bottom: 1px solid rgba(243, 239, 229, 0.22);
  background: transparent;
  color: var(--paper);
  transition: background-color 180ms ease, color 180ms ease;
}

#trusted .trusted-card::before {
  content: "";
  position: absolute;
  inset: 0;
  opacity: 0;
  background: linear-gradient(135deg, rgba(167, 40, 77, 0.98), rgba(139, 28, 61, 0.98));
  transition: opacity 180ms ease;
}

#trusted .trusted-card > * {
  position: relative;
  z-index: 1;
}

#trusted .trusted-card:hover::before {
  opacity: 1;
}

#trusted .trusted-card-1,
#trusted .trusted-card-6,
#trusted .trusted-card-7,
#trusted .trusted-card-8 {
  grid-column: span 2;
}

#trusted .trusted-card-1::before {
  opacity: 1;
}

#trusted .trusted-card-4 {
  background: var(--paper);
  color: var(--dark);
}

#trusted .trusted-card-4::before {
  background: var(--acid);
}

#trusted .trusted-card-4:hover {
  color: var(--paper);
}

#trusted .trusted-index {
  color: currentColor;
  font-size: 11px;
  font-weight: 900;
  letter-spacing: 0.14em;
  opacity: 0.52;
}

#trusted .trusted-name {
  display: block;
  max-width: 94%;
  margin-top: 24px;
  color: currentColor;
  font-family: var(--tfac-font-head);
  font-size: clamp(21px, 2vw, 31px);
  font-weight: 800;
  line-height: 1.02;
  letter-spacing: -0.04em;
  overflow-wrap: anywhere;
}

#trusted .trusted-signal {
  position: absolute;
  right: 22px;
  bottom: 20px;
  width: 10px;
  height: 10px;
  border-radius: 50%;
  background: var(--acid);
  box-shadow: 0 0 0 6px rgba(167, 40, 77, 0.14);
}

#trusted .trusted-card-1 .trusted-signal,
#trusted .trusted-card:hover .trusted-signal {
  background: var(--paper);
  box-shadow: 0 0 0 6px rgba(243, 239, 229, 0.14);
}

#trusted .trusted-card-4 .trusted-signal {
  background: var(--acid);
}

@media (max-width: 1100px) {
  #trusted .trusted-head {
    grid-template-columns: 1fr;
    gap: 26px;
  }

  #trusted .trusted-heading h2,
  #trusted .trusted-intro .lead {
    max-width: 900px;
  }

  #trusted .trusted-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }

  #trusted .trusted-card-1,
  #trusted .trusted-card-6,
  #trusted .trusted-card-7,
  #trusted .trusted-card-8 {
    grid-column: auto;
  }
}

@media (max-width: 700px) {
  #trusted .trusted-head {
    margin-bottom: 34px;
  }

  #trusted .trusted-heading h2 {
    font-size: clamp(44px, 15vw, 66px);
    line-height: 0.86;
  }

  #trusted .trusted-intro {
    gap: 16px;
  }

  #trusted .trusted-intro .lead {
    font-size: 16px;
    line-height: 1.47;
  }

  #trusted .trusted-grid {
    grid-template-columns: 1fr;
  }

  #trusted .trusted-card,
  #trusted .trusted-card-1,
  #trusted .trusted-card-6,
  #trusted .trusted-card-7,
  #trusted .trusted-card-8 {
    grid-column: auto;
    min-height: 112px;
    padding: 20px;
  }

  #trusted .trusted-card-4 {
    background: transparent;
    color: var(--paper);
  }

  #trusted .trusted-card-4::before {
    background: linear-gradient(135deg, rgba(167, 40, 77, 0.98), rgba(139, 28, 61, 0.98));
  }

  #trusted .trusted-name {
    margin-top: 18px;
    font-size: clamp(21px, 7vw, 27px);
  }
}

@media (prefers-reduced-motion: reduce) {
  #trusted .trusted-card,
  #trusted .trusted-card::before {
    transition: none;
  }
}



/* 1.10.2 — trusted partners as logos with active links. */
#trusted {
  position: relative;
  overflow: hidden;
  background: var(--paper);
  color: var(--ink);
  border-top: 1px solid rgba(45, 45, 45, 0.08);
  border-bottom: 1px solid rgba(45, 45, 45, 0.08);
}

#trusted::before,
#trusted::after {
  content: none;
}

#trusted .trusted-container {
  position: relative;
  z-index: 2;
}

#trusted .trusted-head {
  display: grid;
  grid-template-columns: minmax(0, 0.88fr) minmax(320px, 0.82fr);
  gap: clamp(30px, 6vw, 92px);
  align-items: end;
  margin-bottom: clamp(30px, 4vw, 52px);
}

#trusted .eyebrow {
  color: var(--acid);
}

#trusted .trusted-heading h2 {
  max-width: 620px;
  margin: 0;
  color: var(--ink);
  font-size: clamp(34px, 4.2vw, 60px);
  line-height: 0.92;
  letter-spacing: -0.06em;
  text-wrap: balance;
}

#trusted .trusted-intro {
  display: block;
}

#trusted .trusted-intro .lead {
  max-width: 560px;
  margin: 0;
  color: var(--ink);
  font-size: clamp(16px, 1.25vw, 19px);
  line-height: 1.52;
  font-weight: 650;
  opacity: 0.88;
}

#trusted .trusted-meta,
#trusted .trusted-note,
#trusted .trusted-signal {
  display: none !important;
}

#trusted .trusted-grid {
  display: grid;
  grid-template-columns: repeat(4, minmax(0, 1fr));
  gap: 16px;
  border: 0;
}

#trusted .trusted-card,
#trusted .trusted-card-1,
#trusted .trusted-card-4,
#trusted .trusted-card-6,
#trusted .trusted-card-7,
#trusted .trusted-card-8 {
  grid-column: auto;
  min-width: 0;
  min-height: 132px;
  padding: 0;
  overflow: visible;
  border: 0;
  background: transparent;
  color: var(--ink);
}

#trusted .trusted-card::before {
  content: none !important;
}

#trusted .trusted-logo-link {
  position: relative;
  display: flex;
  flex-direction: column;
  justify-content: space-between;
  width: 100%;
  min-height: 132px;
  padding: 18px 18px 16px;
  border: 1px solid rgba(45, 45, 45, 0.1);
  border-radius: 22px;
  background: var(--paper);
  box-shadow: 0 14px 36px rgba(45, 45, 45, 0.07), 0 3px 8px rgba(45, 45, 45, 0.03);
  text-decoration: none;
  color: inherit;
  transition: transform 160ms ease, box-shadow 160ms ease, border-color 160ms ease;
}

#trusted .trusted-logo-link.is-link:hover {
  transform: translateY(-4px);
  border-color: rgba(167, 40, 77, 0.34);
  box-shadow: 0 20px 44px rgba(45, 45, 45, 0.11), 0 5px 12px rgba(45, 45, 45, 0.04);
}

#trusted .trusted-index {
  display: inline-flex;
  align-items: center;
  justify-content: space-between;
  width: 100%;
  color: var(--muted);
  font-size: 11px;
  font-weight: 900;
  letter-spacing: 0.13em;
}

#trusted .trusted-logo-stage {
  display: flex;
  align-items: center;
  justify-content: center;
  min-height: 64px;
  margin-top: 12px;
}

#trusted .trusted-logo-image {
  display: block;
  width: auto;
  max-width: 100%;
  max-height: 54px;
  object-fit: contain;
}

#trusted .trusted-logo-name {
  display: block;
  width: 100%;
  text-align: left;
  color: var(--ink);
  font-family: var(--tfac-font-head);
  font-size: clamp(18px, 1.65vw, 24px);
  font-weight: 800;
  line-height: 1.06;
  letter-spacing: -0.04em;
  overflow-wrap: anywhere;
}

#trusted .trusted-link-indicator {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  align-self: flex-end;
  width: 30px;
  height: 30px;
  margin-top: 12px;
  border-radius: 50%;
  background: rgba(167, 40, 77, 0.12);
  color: var(--acid);
  font-size: 14px;
  font-weight: 900;
  line-height: 1;
}

@media (max-width: 1100px) {
  #trusted .trusted-head {
    grid-template-columns: 1fr;
    gap: 22px;
  }

  #trusted .trusted-heading h2,
  #trusted .trusted-intro .lead {
    max-width: 900px;
  }

  #trusted .trusted-grid {
    grid-template-columns: repeat(3, minmax(0, 1fr));
  }
}

@media (max-width: 820px) {
  #trusted .trusted-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }
}

@media (max-width: 700px) {
  #trusted .trusted-head {
    margin-bottom: 28px;
  }

  #trusted .trusted-heading h2 {
    font-size: clamp(32px, 10vw, 48px);
    line-height: 0.94;
  }

  #trusted .trusted-intro .lead {
    font-size: 15px;
    line-height: 1.46;
  }

  #trusted .trusted-grid {
    grid-template-columns: 1fr;
    gap: 12px;
  }

  #trusted .trusted-logo-link {
    min-height: 112px;
    padding: 16px;
    border-radius: 18px;
  }

  #trusted .trusted-logo-stage {
    min-height: 52px;
  }

  #trusted .trusted-logo-image {
    max-height: 46px;
  }

  #trusted .trusted-logo-name {
    font-size: 18px;
  }
}

@media (prefers-reduced-motion: reduce) {
  #trusted .trusted-logo-link {
    transition: none;
  }
}

/* 1.12.0 — legal data and essential document links in the footer. */
.site-footer .footer-grid.footer-grid-legal {
  grid-template-columns: minmax(280px, 1.2fr) minmax(150px, 0.55fr) minmax(230px, 0.85fr) minmax(190px, 0.7fr);
  gap: clamp(28px, 4vw, 58px);
  align-items: start;
}

.site-footer .footer-column {
  min-width: 0;
}

.site-footer .footer-legal-data {
  display: grid;
  gap: 7px;
  margin: 0;
  color: rgba(243, 239, 229, 0.7);
  font-style: normal;
  font-size: 14px;
  line-height: 1.45;
}

.site-footer .footer-legal-data strong {
  color: var(--paper);
  font-size: 15px;
  line-height: 1.35;
}

.site-footer .footer-legal-data span,
.site-footer .footer-legal-data a {
  display: block;
  color: rgba(243, 239, 229, 0.7);
  overflow-wrap: anywhere;
}

.site-footer .footer-legal-data a:hover,
.site-footer .footer-document-links a:hover {
  color: var(--acid);
}

.site-footer .footer-document-links a {
  display: inline-flex;
  align-items: center;
  gap: 8px;
}

.site-footer .footer-document-links a::after {
  content: "↗";
  color: var(--acid);
  font-size: 11px;
  line-height: 1;
  opacity: 0.9;
}

.cookie-banner .cookie-info-link {
  display: inline-block;
  margin-left: 4px;
  color: var(--acid);
  font-weight: 900;
  text-decoration: underline;
  text-underline-offset: 2px;
}

.cookie-banner .cookie-info-link:hover {
  color: var(--ink);
}

@media (max-width: 1120px) {
  .site-footer .footer-grid.footer-grid-legal {
    grid-template-columns: minmax(260px, 1fr) repeat(2, minmax(190px, 0.72fr));
  }

  .site-footer .footer-documents-column {
    grid-column: 2 / -1;
  }

  .site-footer .footer-document-links {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }
}

@media (max-width: 780px) {
  .site-footer .footer-grid.footer-grid-legal {
    grid-template-columns: 1fr 1fr;
    gap: 34px 24px;
  }

  .site-footer .footer-brand-column,
  .site-footer .footer-documents-column {
    grid-column: 1 / -1;
  }

  .site-footer .footer-document-links {
    grid-template-columns: 1fr 1fr;
  }
}

@media (max-width: 520px) {
  .site-footer .footer-grid.footer-grid-legal {
    grid-template-columns: 1fr;
  }

  .site-footer .footer-brand-column,
  .site-footer .footer-documents-column {
    grid-column: auto;
  }

  .site-footer .footer-document-links {
    grid-template-columns: 1fr;
  }

  .site-footer .footer-bottom {
    align-items: flex-start;
    flex-direction: column;
  }
}

/* 1.13.0 — generated legal pages and dedicated legal-document design. */
.legal-page-hero {
  position: relative;
  overflow: hidden;
  padding: clamp(92px, 11vw, 150px) 0 clamp(62px, 7vw, 96px);
  background: var(--dark);
  color: var(--paper);
}

.legal-page-hero::before {
  content: "";
  position: absolute;
  width: min(42vw, 560px);
  aspect-ratio: 1;
  right: -12vw;
  top: -56%;
  border: 1px solid rgba(243, 239, 229, 0.2);
  border-radius: 50%;
}

.legal-page-hero::after {
  content: "";
  position: absolute;
  left: 0;
  right: 0;
  bottom: 0;
  height: 6px;
  background: var(--acid);
}

.legal-page-hero-grid {
  position: relative;
  z-index: 2;
  display: grid;
  grid-template-columns: minmax(0, 1.2fr) minmax(280px, 0.48fr);
  gap: clamp(36px, 7vw, 110px);
  align-items: end;
}

.legal-page-hero .eyebrow {
  color: var(--acid);
}

.legal-page-hero h1 {
  max-width: 880px;
  margin: 0;
  color: var(--paper);
  font-size: clamp(44px, 6.5vw, 94px);
  line-height: 0.88;
  letter-spacing: -0.075em;
  text-wrap: balance;
}

.legal-page-hero .lead {
  max-width: 760px;
  margin: 24px 0 0;
  color: var(--paper);
  font-size: clamp(17px, 1.55vw, 22px);
  line-height: 1.5;
  opacity: 0.84;
}

.legal-page-meta-card {
  display: grid;
  gap: 12px;
  padding: 24px;
  border: 1px solid rgba(243, 239, 229, 0.22);
  border-radius: 24px;
  background: rgba(243, 239, 229, 0.04);
}

.legal-page-meta-label {
  color: var(--acid);
  font-size: 11px;
  font-weight: 900;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

.legal-page-meta-card strong {
  color: var(--paper);
  font-size: 18px;
  line-height: 1.25;
}

.legal-page-meta-card > span:last-child {
  color: var(--paper);
  font-size: 14px;
  line-height: 1.45;
  opacity: 0.68;
}

.legal-page-body {
  padding: clamp(56px, 8vw, 110px) 0;
  background: var(--paper);
}

.legal-document-layout {
  display: grid;
  grid-template-columns: minmax(210px, 0.3fr) minmax(0, 1fr);
  gap: clamp(30px, 5vw, 76px);
  align-items: start;
}

.legal-toc {
  position: sticky;
  top: 110px;
  padding: 22px;
  border: 1px solid rgba(45, 45, 45, 0.11);
  border-radius: 22px;
  background: rgba(45, 45, 45, 0.025);
}

.legal-toc > strong {
  display: block;
  margin-bottom: 14px;
  color: var(--acid);
  font-size: 12px;
  font-weight: 900;
  letter-spacing: 0.12em;
  text-transform: uppercase;
}

.legal-toc ol {
  display: grid;
  gap: 9px;
  margin: 0;
  padding: 0;
  list-style: none;
}

.legal-toc a {
  display: block;
  padding: 5px 0;
  color: var(--ink);
  font-size: 14px;
  font-weight: 700;
  line-height: 1.35;
  text-decoration: none;
  opacity: 0.72;
}

.legal-toc a:hover,
.legal-toc a:focus-visible {
  color: var(--acid);
  opacity: 1;
}

.legal-document {
  min-width: 0;
  display: grid;
  gap: 16px;
}

.legal-notice-card {
  margin-bottom: 8px;
  padding: 20px 22px;
  border-left: 5px solid var(--acid);
  border-radius: 0 18px 18px 0;
  background: rgba(167, 40, 77, 0.08);
  color: var(--ink);
  font-size: 15px;
  font-weight: 700;
  line-height: 1.5;
}

.legal-section-card {
  scroll-margin-top: 110px;
  padding: clamp(24px, 3.5vw, 42px);
  border: 1px solid rgba(45, 45, 45, 0.1);
  border-radius: 26px;
  background: var(--paper);
  box-shadow: 0 16px 44px rgba(45, 45, 45, 0.05);
}

.legal-section-card h2 {
  max-width: 900px;
  margin: 0 0 18px;
  color: var(--ink);
  font-size: clamp(24px, 2.5vw, 36px);
  line-height: 1.05;
  letter-spacing: -0.045em;
}

.legal-section-content {
  color: var(--ink);
  font-size: 16px;
  line-height: 1.72;
}

.legal-section-content p,
.legal-section-content ul,
.legal-section-content ol {
  margin: 0 0 16px;
}

.legal-section-content > :last-child {
  margin-bottom: 0;
}

.legal-section-content ul,
.legal-section-content ol {
  padding-left: 22px;
}

.legal-section-content li + li {
  margin-top: 8px;
}

.legal-section-content a {
  color: var(--acid);
  font-weight: 800;
  text-underline-offset: 3px;
}

.legal-data-card {
  display: grid;
  margin: 22px 0 0;
  border-top: 1px solid rgba(45, 45, 45, 0.12);
}

.legal-data-row {
  display: grid;
  grid-template-columns: minmax(120px, 0.28fr) minmax(0, 1fr);
  gap: 18px;
  padding: 14px 0;
  border-bottom: 1px solid rgba(45, 45, 45, 0.12);
}

.legal-data-row dt {
  color: var(--muted);
  font-size: 12px;
  font-weight: 900;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.legal-data-row dd {
  margin: 0;
  color: var(--ink);
  font-weight: 750;
}

.legal-table-wrap {
  overflow-x: auto;
  border: 1px solid rgba(45, 45, 45, 0.12);
  border-radius: 18px;
}

.legal-table-wrap table {
  width: 100%;
  min-width: 620px;
  border-collapse: collapse;
}

.legal-table-wrap th,
.legal-table-wrap td {
  padding: 15px 16px;
  border-bottom: 1px solid rgba(45, 45, 45, 0.1);
  text-align: left;
  vertical-align: top;
}

.legal-table-wrap th {
  background: rgba(45, 45, 45, 0.04);
  color: var(--ink);
  font-size: 12px;
  font-weight: 900;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.legal-table-wrap tr:last-child td {
  border-bottom: 0;
}

.legal-table-wrap code {
  color: var(--acid);
  font-size: 13px;
  font-weight: 800;
}

.legal-reset-consent {
  margin-top: 6px;
}

.legal-back-link {
  display: inline-flex;
  width: fit-content;
  margin-top: 12px;
  color: var(--ink);
  font-weight: 900;
  text-decoration: none;
}

.legal-back-link:hover {
  color: var(--acid);
}

@media (max-width: 980px) {
  .legal-page-hero-grid,
  .legal-document-layout {
    grid-template-columns: 1fr;
  }

  .legal-page-meta-card {
    max-width: 560px;
  }

  .legal-toc {
    position: static;
  }

  .legal-toc ol {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    column-gap: 20px;
  }
}

@media (max-width: 660px) {
  .legal-page-hero {
    padding-top: 78px;
  }

  .legal-page-hero h1 {
    font-size: clamp(40px, 13vw, 58px);
    line-height: 0.91;
  }

  .legal-page-meta-card,
  .legal-toc,
  .legal-section-card {
    border-radius: 18px;
  }

  .legal-toc ol {
    grid-template-columns: 1fr;
  }

  .legal-data-row {
    grid-template-columns: 1fr;
    gap: 5px;
  }

  .legal-section-content {
    font-size: 15px;
    line-height: 1.65;
  }
}


/* 1.13.3 — legal operator trust presentation */
.site-footer .footer-operator {
  max-width: 420px;
  margin: 14px 0 0;
  padding: 14px 16px;
  border: 1px solid rgba(243, 239, 229, 0.18);
  border-radius: 16px;
  color: var(--paper);
  font-size: 13px;
  font-weight: 650;
  line-height: 1.48;
  opacity: 0.9;
}
.site-footer .footer-operator a {
  color: var(--paper);
  font-weight: 850;
  text-decoration: underline;
  text-underline-offset: 3px;
}
#about .about-facts .about-legal-proof {
  border-color: rgba(167, 40, 77, 0.28);
}
#about .about-facts .about-legal-proof .tick {
  box-shadow: inset 0 -5px 0 rgba(45,45,45,.11), 0 0 0 7px rgba(167,40,77,.1);
}

#about .about-facts li:nth-child(4) { transform: translateX(14px); }
#about .about-facts li:nth-child(4):hover { transform: translate(14px, -4px); }
@media (max-width:760px) {
  #about .about-facts li:nth-child(4),
  #about .about-facts li:nth-child(4):hover { transform:none; }
}


/* 1.13.4 — reliable clean language routes + rebuilt compact legal footer. */
.site-footer {
  position: relative;
  overflow: hidden;
  padding: clamp(54px, 7vw, 86px) 0 24px;
  background: var(--dark);
  color: var(--paper);
  border-top: 5px solid var(--acid);
}

.site-footer::after {
  content: "";
  position: absolute;
  top: -160px;
  right: -150px;
  width: 390px;
  height: 390px;
  border: 1px solid rgba(243, 239, 229, 0.08);
  border-radius: 50%;
  pointer-events: none;
}

.site-footer .footer-shell {
  position: relative;
  z-index: 2;
}

.site-footer .footer-topline {
  display: grid;
  grid-template-columns: minmax(0, 1.25fr) minmax(310px, 0.62fr);
  gap: clamp(38px, 7vw, 110px);
  align-items: end;
  padding-bottom: clamp(34px, 4.5vw, 54px);
  border-bottom: 1px solid rgba(243, 239, 229, 0.16);
}

.site-footer .footer-brand-block {
  min-width: 0;
}

.site-footer .footer-brand {
  display: inline-flex;
  width: fit-content;
}

.site-footer .footer-brand .brand-logo,
.site-footer .footer-brand .brand-logo img {
  width: auto;
  max-width: 235px;
  max-height: 78px;
  object-fit: contain;
}

.site-footer .footer-about {
  max-width: 690px;
  margin: 24px 0 0;
  color: rgba(243, 239, 229, 0.72);
  font-size: clamp(16px, 1.4vw, 20px);
  font-weight: 650;
  line-height: 1.5;
}

.site-footer .footer-contact-card {
  display: grid;
  gap: 10px;
  padding: 24px;
  border-radius: 24px;
  background: var(--acid);
  color: var(--paper);
  box-shadow: 0 18px 50px rgba(0, 0, 0, 0.16);
}

.site-footer .footer-contact-label,
.site-footer .footer-company-label {
  color: currentColor;
  font-size: 11px;
  font-weight: 900;
  letter-spacing: 0.14em;
  text-transform: uppercase;
  opacity: 0.72;
}

.site-footer .footer-contact-email {
  color: var(--paper) !important;
  font-family: var(--tfac-font-head);
  font-size: clamp(19px, 2vw, 28px);
  font-weight: 800;
  line-height: 1.06;
  letter-spacing: -0.035em;
  overflow-wrap: anywhere;
  text-decoration: none;
}

.site-footer .footer-contact-cta {
  display: inline-flex;
  align-items: center;
  justify-content: space-between;
  gap: 16px;
  width: 100%;
  margin-top: 8px;
  padding-top: 14px;
  border-top: 1px solid rgba(243, 239, 229, 0.28);
  color: var(--paper) !important;
  font-size: 13px;
  font-weight: 900;
  letter-spacing: 0.06em;
  text-transform: uppercase;
  text-decoration: none;
}

.site-footer .footer-main-grid {
  display: grid;
  grid-template-columns: minmax(150px, 0.58fr) minmax(220px, 0.88fr) minmax(300px, 1.08fr);
  gap: clamp(34px, 5vw, 76px);
  align-items: start;
  padding: clamp(38px, 5vw, 60px) 0;
}

.site-footer .footer-column,
.site-footer .footer-company-card {
  min-width: 0;
}

.site-footer .footer-heading {
  margin: 0 0 18px;
  color: var(--paper);
  font-size: 13px;
  line-height: 1;
  letter-spacing: 0.1em;
  text-transform: uppercase;
}

.site-footer .footer-links {
  display: grid;
  gap: 11px;
  margin: 0;
  padding: 0;
  list-style: none;
}

.site-footer .footer-primary-links {
  grid-template-columns: 1fr;
}

.site-footer .footer-document-links {
  grid-template-columns: repeat(2, minmax(0, 1fr));
  column-gap: 22px;
}

.site-footer .footer-links a,
.site-footer .footer-document-links a {
  display: inline-flex;
  align-items: center;
  width: fit-content;
  padding: 2px 0;
  color: rgba(243, 239, 229, 0.72);
  font-size: 14px;
  font-weight: 650;
  line-height: 1.35;
  text-decoration: none;
  transition: color 150ms ease, transform 150ms ease;
}

.site-footer .footer-document-links a::after {
  content: none;
}

.site-footer .footer-links a:hover,
.site-footer .footer-links a:focus-visible {
  color: var(--paper);
  transform: translateX(3px);
  text-decoration: none;
}

.site-footer .footer-company-card {
  display: grid;
  gap: 12px;
  padding: clamp(22px, 2.5vw, 30px);
  border: 1px solid rgba(243, 239, 229, 0.15);
  border-radius: 24px;
  background: rgba(243, 239, 229, 0.055);
}

.site-footer .footer-company-label {
  color: var(--acid);
  opacity: 1;
}

.site-footer .footer-company-name {
  color: var(--paper);
  font-family: var(--tfac-font-head);
  font-size: clamp(19px, 1.7vw, 25px);
  line-height: 1.1;
  letter-spacing: -0.03em;
}

.site-footer .footer-company-meta {
  display: flex;
  flex-wrap: wrap;
  gap: 8px;
}

.site-footer .footer-company-meta span {
  display: inline-flex;
  align-items: center;
  min-height: 30px;
  padding: 6px 10px;
  border-radius: 999px;
  background: rgba(243, 239, 229, 0.08);
  color: rgba(243, 239, 229, 0.72);
  font-size: 12px;
  font-weight: 750;
  line-height: 1;
}

.site-footer .footer-company-link {
  display: inline-flex;
  align-items: center;
  justify-content: space-between;
  gap: 14px;
  margin-top: 4px;
  padding-top: 14px;
  border-top: 1px solid rgba(243, 239, 229, 0.13);
  color: var(--paper) !important;
  font-size: 13px;
  font-weight: 850;
  text-decoration: none;
}

.site-footer .footer-operator-line {
  display: flex;
  align-items: flex-start;
  gap: 12px;
  padding: 18px 0;
  border-top: 1px solid rgba(243, 239, 229, 0.12);
  border-bottom: 1px solid rgba(243, 239, 229, 0.12);
}

.site-footer .footer-operator-mark {
  flex: 0 0 auto;
  color: var(--acid);
  font-size: 10px;
  line-height: 1.8;
}

.site-footer .footer-operator-line p {
  max-width: 980px;
  margin: 0;
  color: rgba(243, 239, 229, 0.62);
  font-size: 13px;
  font-weight: 600;
  line-height: 1.55;
}

.site-footer .footer-bottom {
  display: grid;
  grid-template-columns: 1fr auto 1fr;
  gap: 20px;
  align-items: center;
  padding-top: 20px;
  color: rgba(243, 239, 229, 0.52);
  font-size: 11px;
  font-weight: 850;
  letter-spacing: 0.09em;
  text-transform: uppercase;
}

.site-footer .footer-bottom > span:last-child {
  text-align: right;
}

.site-footer .footer-lang-switch {
  display: inline-flex;
  align-items: center;
  gap: 5px;
  padding: 4px;
  border: 1px solid rgba(243, 239, 229, 0.14);
  border-radius: 999px;
}

.site-footer .footer-lang-switch a {
  display: grid;
  place-items: center;
  min-width: 38px;
  min-height: 30px;
  padding: 0 10px;
  border-radius: 999px;
  color: rgba(243, 239, 229, 0.62);
  font-size: 10px;
  font-weight: 900;
  letter-spacing: 0.08em;
  text-decoration: none;
}

.site-footer .footer-lang-switch a.active {
  background: var(--acid);
  color: var(--paper);
}

.site-footer .footer-lang-switch a:hover,
.site-footer .footer-lang-switch a:focus-visible {
  color: var(--paper);
}

/* Retire the previous boxed operator treatment. */
.site-footer .footer-operator {
  display: none !important;
}

@media (max-width: 980px) {
  .site-footer .footer-topline {
    grid-template-columns: 1fr;
    align-items: start;
  }

  .site-footer .footer-contact-card {
    width: min(560px, 100%);
  }

  .site-footer .footer-main-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }

  .site-footer .footer-company-card {
    grid-column: 1 / -1;
  }
}

@media (max-width: 640px) {
  .site-footer {
    padding-top: 48px;
  }

  .site-footer .footer-brand .brand-logo,
  .site-footer .footer-brand .brand-logo img {
    max-width: 205px;
    max-height: 68px;
  }

  .site-footer .footer-topline,
  .site-footer .footer-main-grid {
    gap: 30px;
  }

  .site-footer .footer-main-grid {
    grid-template-columns: 1fr;
    padding: 38px 0;
  }

  .site-footer .footer-company-card {
    grid-column: auto;
  }

  .site-footer .footer-document-links {
    grid-template-columns: 1fr;
  }

  .site-footer .footer-bottom {
    grid-template-columns: 1fr;
    justify-items: start;
  }

  .site-footer .footer-bottom > span:last-child {
    text-align: left;
  }

  .site-footer .footer-lang-switch {
    order: -1;
  }
}

@media (prefers-reduced-motion: reduce) {
  .site-footer .footer-links a {
    transition: none;
  }
}

/* 1.13.5 — language switch transition and interaction polish. */
.language-transition {
  position: fixed;
  inset: 0;
  z-index: 999999;
  display: grid;
  place-items: center;
  overflow: hidden;
  background: var(--dark);
  color: var(--paper);
  pointer-events: none;
  transform: translateY(104%);
  transition: transform 440ms cubic-bezier(0.76, 0, 0.24, 1);
  will-change: transform;
}

.language-transition::before,
.language-transition::after {
  content: "";
  position: absolute;
  border-radius: 50%;
  pointer-events: none;
}

.language-transition::before {
  width: min(52vw, 700px);
  aspect-ratio: 1;
  border: 1px solid rgba(167, 40, 77, 0.72);
  transform: translate(-42vw, 36vh);
}

.language-transition::after {
  width: min(28vw, 360px);
  aspect-ratio: 1;
  background: var(--acid);
  opacity: 0.92;
  transform: translate(44vw, -38vh);
}

.language-transition-inner {
  position: relative;
  z-index: 2;
  display: grid;
  justify-items: center;
  gap: 14px;
}

.language-transition-brand {
  color: var(--paper);
  font-family: var(--tfac-font-body);
  font-size: clamp(14px, 1.4vw, 20px);
  font-weight: 850;
  letter-spacing: 0.08em;
  text-transform: lowercase;
}

.language-transition-code {
  color: var(--paper);
  font-family: var(--tfac-font-head);
  font-size: clamp(68px, 14vw, 180px);
  font-weight: 900;
  line-height: 0.78;
  letter-spacing: -0.08em;
}

body.tfac-lang-leaving {
  overflow: hidden;
}

body.tfac-lang-leaving .language-transition {
  transform: translateY(0);
  pointer-events: auto;
}

html.tfac-lang-arriving .language-transition {
  transform: translateY(0);
  transition: none;
}

html.tfac-lang-arriving.tfac-lang-arrived .language-transition {
  transform: translateY(-104%);
  transition: transform 540ms cubic-bezier(0.76, 0, 0.24, 1);
}

.lang-switch a,
.site-footer .footer-lang-switch a {
  transition:
    color 160ms ease,
    background-color 160ms ease,
    border-color 160ms ease,
    transform 160ms ease,
    opacity 160ms ease;
}

.lang-switch a:hover,
.lang-switch a:focus-visible,
.site-footer .footer-lang-switch a:hover,
.site-footer .footer-lang-switch a:focus-visible {
  transform: translateY(-2px);
}

.lang-switch a.active,
.site-footer .footer-lang-switch a.active {
  transform: none;
}

@media (max-width: 700px) {
  .language-transition::before {
    width: 110vw;
    transform: translate(-58vw, 38vh);
  }

  .language-transition::after {
    width: 54vw;
    transform: translate(52vw, -36vh);
  }
}

@media (prefers-reduced-motion: reduce) {
  .language-transition,
  html.tfac-lang-arriving.tfac-lang-arrived .language-transition,
  .lang-switch a,
  .site-footer .footer-lang-switch a {
    transition-duration: 1ms !important;
  }
}


/* 1.13.6 — faster, non-blocking language transition. */
.language-transition {
  transition-duration: 320ms;
}

html.tfac-lang-arriving.tfac-lang-arrived .language-transition {
  transition-duration: 400ms;
}

.language-transition-code {
  font-size: clamp(54px, 10vw, 124px);
}

/* 1.13.7 — logo-based language preloader with draw animation. */
.language-transition {
  background:
    radial-gradient(circle at 18% 78%, rgba(167, 40, 77, 0.16), transparent 28%),
    radial-gradient(circle at 84% 18%, rgba(167, 40, 77, 0.22), transparent 18%),
    var(--dark);
}

.language-transition::before {
  width: min(48vw, 620px);
  border-color: rgba(243, 239, 229, 0.12);
  transform: translate(-43vw, 38vh);
}

.language-transition::after {
  width: min(26vw, 320px);
  background: rgba(167, 40, 77, 0.22);
  transform: translate(42vw, -36vh);
}

.language-transition-inner {
  gap: 0;
}

.language-transition-logo {
  width: min(72vw, 560px);
  max-width: 560px;
}

.language-transition-logo-svg {
  display: block;
  width: 100%;
  height: auto;
  overflow: visible;
}

.language-transition-mark .lt-path {
  opacity: 1;
  stroke-dasharray: 420;
  stroke-dashoffset: 420;
}

.language-transition-wordmark,
.language-transition .lt-dot {
  opacity: 0;
}

body.tfac-lang-leaving .language-transition-mark .lt-path {
  animation: tfacLogoDraw 0.9s cubic-bezier(0.65, 0, 0.35, 1) forwards;
}

body.tfac-lang-leaving .language-transition-mark .lt-path-1 { animation-delay: 0.02s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-2 { animation-delay: 0.08s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-3 { animation-delay: 0.15s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-4 { animation-delay: 0.21s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-5 { animation-delay: 0.3s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-6 { animation-delay: 0.38s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-7 { animation-delay: 0.46s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-8 { animation-delay: 0.52s; }
body.tfac-lang-leaving .language-transition-mark .lt-path-9 { animation-delay: 0.58s; }

body.tfac-lang-leaving .language-transition .lt-dot {
  animation: tfacLogoPop 0.38s cubic-bezier(0.2, 0.8, 0.2, 1) 0.62s forwards;
  transform-origin: center;
}

body.tfac-lang-leaving .language-transition-wordmark {
  animation: tfacLogoFade 0.42s ease 0.7s forwards;
}

html.tfac-lang-arriving .language-transition-mark .lt-path {
  stroke-dashoffset: 0;
}

html.tfac-lang-arriving .language-transition .lt-dot,
html.tfac-lang-arriving .language-transition-wordmark {
  opacity: 1;
}

@keyframes tfacLogoDraw {
  from {
    stroke-dashoffset: var(--lt-length, 420);
  }
  to {
    stroke-dashoffset: 0;
  }
}

@keyframes tfacLogoPop {
  0% {
    opacity: 0;
    transform: scale(0.2);
  }
  70% {
    opacity: 1;
    transform: scale(1.08);
  }
  100% {
    opacity: 1;
    transform: scale(1);
  }
}

@keyframes tfacLogoFade {
  from {
    opacity: 0;
    transform: translateY(6px);
  }
  to {
    opacity: 1;
    transform: translateY(0);
  }
}

@media (max-width: 700px) {
  .language-transition-logo {
    width: min(82vw, 360px);
  }

  .language-transition-wordmark {
    opacity: 0 !important;
  }
}

@media (prefers-reduced-motion: reduce) {
  .language-transition-mark .lt-path,
  body.tfac-lang-leaving .language-transition-mark .lt-path,
  body.tfac-lang-leaving .language-transition .lt-dot,
  body.tfac-lang-leaving .language-transition-wordmark {
    animation: none !important;
  }

  .language-transition-mark .lt-path {
    stroke-dasharray: none !important;
    stroke-dashoffset: 0 !important;
  }

  .language-transition-wordmark,
  .language-transition .lt-dot {
    opacity: 1 !important;
  }
}

/* 1.13.8 — exact approved white logo in the language preloader. */
.language-transition-logo {
  width: min(78vw, 680px);
  max-width: 680px;
}

.language-transition-logo-svg {
  display: block;
  width: 100%;
  height: auto;
  overflow: visible;
}

/* Draw only the real symbol paths from the approved SVG. */
.language-transition-logo-svg #g12 path {
  stroke-dasharray: var(--lt-length, 500);
  stroke-dashoffset: var(--lt-length, 500);
}

/* The original symbol dot and wordmark reveal after the symbol is drawn. */
.language-transition-logo-svg #circle12,
.language-transition-logo-svg #text13,
.language-transition-logo-svg #circle13,
.language-transition-logo-svg #text14 {
  opacity: 0;
}

.language-transition-logo-svg #text13,
.language-transition-logo-svg #circle13,
.language-transition-logo-svg #text14 {
  clip-path: inset(0 100% 0 0);
}

body.tfac-lang-leaving .language-transition-logo-svg #g12 path {
  animation: tfacApprovedLogoDraw 0.62s cubic-bezier(0.65, 0, 0.35, 1) forwards;
}

body.tfac-lang-leaving .language-transition-logo-svg #g12 #path4 { animation-delay: 0.00s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path5 { animation-delay: 0.04s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path6 { animation-delay: 0.08s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path7 { animation-delay: 0.12s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path8 { animation-delay: 0.17s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path9 { animation-delay: 0.21s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path10 { animation-delay: 0.25s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path11 { animation-delay: 0.28s; }
body.tfac-lang-leaving .language-transition-logo-svg #g12 #path12 { animation-delay: 0.31s; }

body.tfac-lang-leaving .language-transition-logo-svg #circle12 {
  transform-box: fill-box;
  transform-origin: center;
  animation: tfacApprovedLogoDot 0.28s cubic-bezier(0.2, 0.8, 0.2, 1) 0.48s forwards;
}

body.tfac-lang-leaving .language-transition-logo-svg #text13,
body.tfac-lang-leaving .language-transition-logo-svg #circle13,
body.tfac-lang-leaving .language-transition-logo-svg #text14 {
  animation: tfacApprovedWordmarkReveal 0.34s ease 0.52s forwards;
}

html.tfac-lang-arriving .language-transition-logo-svg #g12 path {
  stroke-dashoffset: 0;
}

html.tfac-lang-arriving .language-transition-logo-svg #circle12,
html.tfac-lang-arriving .language-transition-logo-svg #text13,
html.tfac-lang-arriving .language-transition-logo-svg #circle13,
html.tfac-lang-arriving .language-transition-logo-svg #text14 {
  opacity: 1;
  clip-path: inset(0 0 0 0);
}

@keyframes tfacApprovedLogoDraw {
  from {
    stroke-dashoffset: var(--lt-length, 500);
  }
  to {
    stroke-dashoffset: 0;
  }
}

@keyframes tfacApprovedLogoDot {
  0% {
    opacity: 0;
    transform: scale(0.2);
  }
  72% {
    opacity: 1;
    transform: scale(1.08);
  }
  100% {
    opacity: 1;
    transform: scale(1);
  }
}

@keyframes tfacApprovedWordmarkReveal {
  from {
    opacity: 0;
    clip-path: inset(0 100% 0 0);
  }
  to {
    opacity: 1;
    clip-path: inset(0 0 0 0);
  }
}

@media (max-width: 700px) {
  .language-transition-logo {
    width: min(88vw, 440px);
  }

  /* Keep the full approved horizontal logo visible on mobile too. */
  .language-transition-logo-svg #text13,
  .language-transition-logo-svg #circle13,
  .language-transition-logo-svg #text14 {
    display: block;
  }
}

@media (prefers-reduced-motion: reduce) {
  .language-transition-logo-svg #g12 path,
  body.tfac-lang-leaving .language-transition-logo-svg #g12 path,
  body.tfac-lang-leaving .language-transition-logo-svg #circle12,
  body.tfac-lang-leaving .language-transition-logo-svg #text13,
  body.tfac-lang-leaving .language-transition-logo-svg #circle13,
  body.tfac-lang-leaving .language-transition-logo-svg #text14 {
    animation: none !important;
  }

  .language-transition-logo-svg #g12 path {
    stroke-dasharray: none !important;
    stroke-dashoffset: 0 !important;
  }

  .language-transition-logo-svg #circle12,
  .language-transition-logo-svg #text13,
  .language-transition-logo-svg #circle13,
  .language-transition-logo-svg #text14 {
    opacity: 1 !important;
    clip-path: inset(0 0 0 0) !important;
  }
}

/* 1.13.9 — true page preloader, visible before the site, with enough time on mobile. */
html.tfac-site-loading body > *:not(#languageTransition) {
  visibility: hidden !important;
}

html.tfac-site-loading.tfac-site-loaded body > *:not(#languageTransition) {
  visibility: visible !important;
}

html.tfac-site-loading .language-transition {
  transform: translateY(0) !important;
  pointer-events: auto;
}

html.tfac-site-loading.tfac-site-loaded .language-transition {
  transform: translateY(-104%) !important;
  transition: transform 580ms cubic-bezier(0.76, 0, 0.24, 1) !important;
}

html:not(.tfac-site-loading) body:not(.tfac-lang-leaving) .language-transition {
  transform: translateY(104%);
}

html.tfac-preloader-animate .language-transition-logo-svg #g12 path {
  animation: tfacApprovedLogoDraw 0.72s cubic-bezier(0.65, 0, 0.35, 1) forwards;
}

html.tfac-preloader-animate .language-transition-logo-svg #g12 #path4 { animation-delay: 0.00s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path5 { animation-delay: 0.05s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path6 { animation-delay: 0.10s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path7 { animation-delay: 0.15s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path8 { animation-delay: 0.21s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path9 { animation-delay: 0.27s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path10 { animation-delay: 0.33s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path11 { animation-delay: 0.38s; }
html.tfac-preloader-animate .language-transition-logo-svg #g12 #path12 { animation-delay: 0.43s; }

html.tfac-preloader-animate .language-transition-logo-svg #circle12 {
  transform-box: fill-box;
  transform-origin: center;
  animation: tfacApprovedLogoDot 0.34s cubic-bezier(0.2, 0.8, 0.2, 1) 0.72s forwards;
}

html.tfac-preloader-animate .language-transition-logo-svg #text13,
html.tfac-preloader-animate .language-transition-logo-svg #circle13,
html.tfac-preloader-animate .language-transition-logo-svg #text14 {
  animation: tfacApprovedWordmarkReveal 0.42s ease 0.78s forwards;
}

body.tfac-lang-leaving .language-transition {
  transform: translateY(0) !important;
  transition: transform 380ms cubic-bezier(0.76, 0, 0.24, 1) !important;
}

@media (max-width: 700px) {
  .language-transition-logo {
    width: min(90vw, 430px);
  }

  html.tfac-site-loading.tfac-site-loaded .language-transition {
    transition-duration: 620ms !important;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #g12 path {
    animation-duration: 0.82s;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #circle12 {
    animation-delay: 0.82s;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #text13,
  html.tfac-preloader-animate .language-transition-logo-svg #circle13,
  html.tfac-preloader-animate .language-transition-logo-svg #text14 {
    animation-delay: 0.9s;
    animation-duration: 0.46s;
  }
}

@media (prefers-reduced-motion: reduce) {
  html.tfac-site-loading.tfac-site-loaded .language-transition,
  body.tfac-lang-leaving .language-transition {
    transition-duration: 1ms !important;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #g12 path,
  html.tfac-preloader-animate .language-transition-logo-svg #circle12,
  html.tfac-preloader-animate .language-transition-logo-svg #text13,
  html.tfac-preloader-animate .language-transition-logo-svg #circle13,
  html.tfac-preloader-animate .language-transition-logo-svg #text14 {
    animation: none !important;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #g12 path {
    stroke-dasharray: none !important;
    stroke-dashoffset: 0 !important;
  }

  html.tfac-preloader-animate .language-transition-logo-svg #circle12,
  html.tfac-preloader-animate .language-transition-logo-svg #text13,
  html.tfac-preloader-animate .language-transition-logo-svg #circle13,
  html.tfac-preloader-animate .language-transition-logo-svg #text14 {
    opacity: 1 !important;
    clip-path: inset(0 0 0 0) !important;
  }
}


/* 1.14.0 — final mobile hero hierarchy and compact header. */
@media (max-width: 760px) {
  .site-header .container {
    width: calc(100% - 20px);
  }

  .header-inner {
    height: 66px;
    gap: 8px;
  }

  .brand {
    max-width: 150px;
    flex: 0 1 150px;
  }

  .brand-logo,
  .brand-logo img {
    width: auto;
    max-width: 150px;
    max-height: 50px;
  }

  .lang-switch {
    margin-left: auto;
    flex: 0 0 auto;
    border-width: 1.5px;
  }

  .lang-switch a {
    min-width: 34px;
    height: 40px;
    border-right-width: 1.5px;
    font-size: 10px;
    letter-spacing: 0;
  }

  .menu-toggle {
    flex: 0 0 42px;
    width: 42px;
    height: 42px;
    border-width: 1.5px;
    font-size: 21px;
  }

  .main-nav {
    top: calc(66px + env(safe-area-inset-top));
    left: 10px;
    right: 10px;
  }

  .agency-hero {
    padding: 28px 0 38px;
  }

  .agency-hero::before {
    background-size: 52px 52px;
  }

  .hero-badges {
    display: flex;
    flex-wrap: nowrap;
    gap: 8px;
    width: 100%;
    margin: 0 0 24px;
    padding: 0 0 4px;
    overflow-x: auto;
    border: 0;
    scrollbar-width: none;
    -webkit-overflow-scrolling: touch;
  }

  .hero-badges::-webkit-scrollbar {
    display: none;
  }

  .hero-badges span,
  .hero-badges span:nth-child(2n),
  .hero-badges span:nth-last-child(-n + 2) {
    flex: 0 0 auto;
    min-height: 34px;
    padding: 0 13px;
    border: 1.5px solid var(--paper);
    background: transparent;
    color: var(--paper);
    font-size: 10px;
    letter-spacing: 0.08em;
  }

  .hero-badges span:nth-child(2n) {
    background: var(--paper);
    color: var(--ink);
  }

  .agency-hero .eyebrow {
    margin-bottom: 15px;
    font-size: 11px;
    letter-spacing: 0.14em;
  }

  .hero-display {
    margin-bottom: 20px;
    line-height: 0.9;
    letter-spacing: -0.065em;
  }

  .hero-display-top {
    font-size: clamp(44px, 12.8vw, 58px);
    line-height: 0.9;
    letter-spacing: -0.065em;
  }

  .hero-display-bottom {
    margin-top: 5px;
    font-size: clamp(42px, 12vw, 55px);
    line-height: 0.9;
    letter-spacing: -0.065em;
  }

  .hero-lead {
    max-width: none;
    margin-top: 0;
    color: rgba(243, 239, 229, 0.82);
    font-size: 18px;
    font-weight: 600;
    line-height: 1.46;
    letter-spacing: -0.012em;
  }

  .hero-actions {
    display: grid;
    grid-template-columns: 1fr;
    gap: 10px;
    margin-top: 24px;
  }

  .hero-actions .btn {
    width: 100%;
    min-height: 54px;
    padding: 12px 16px;
    font-size: 12px;
    letter-spacing: 0.075em;
  }

  .agency-hero .hero-actions .btn-yellow {
    background: var(--acid);
    color: var(--paper);
    border-color: var(--paper);
  }

  .agency-hero .hero-actions .btn-ghost {
    min-height: 50px;
    background: transparent;
    color: var(--paper);
    border-color: rgba(243, 239, 229, 0.82);
  }

  .hero-note {
    gap: 11px;
    max-width: none;
    margin-top: 20px;
    color: rgba(243, 239, 229, 0.74);
    font-size: 15px;
    font-weight: 650;
    line-height: 1.45;
    letter-spacing: 0;
    text-transform: none;
  }

  .hero-note .note-dot {
    width: 9px;
    height: 9px;
    margin-top: 6px;
  }
}

@media (max-width: 420px) {
  .header-inner {
    height: 64px;
  }

  .brand {
    max-width: 138px;
    flex-basis: 138px;
  }

  .brand-logo,
  .brand-logo img {
    max-width: 138px;
    max-height: 46px;
  }

  .lang-switch a {
    min-width: 32px;
    height: 38px;
    font-size: 9px;
  }

  .menu-toggle {
    flex-basis: 40px;
    width: 40px;
    height: 40px;
  }

  .main-nav {
    top: calc(64px + env(safe-area-inset-top));
  }

  .agency-hero {
    padding-top: 24px;
  }

  .hero-display-top {
    font-size: clamp(42px, 12.4vw, 52px);
  }

  .hero-display-bottom {
    font-size: clamp(40px, 11.7vw, 49px);
  }

  .hero-lead {
    font-size: 17px;
  }
}

/* 1.15.0 — multi-currency pricing. EUR is the primary currency. */
#prices .price-section-intro {
  display: grid;
  gap: 20px;
  align-self: end;
}

#prices .currency-control {
  display: grid;
  gap: 10px;
  width: 100%;
}

#prices .currency-label {
  color: var(--paper);
  font-size: 11px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.13em;
  text-transform: uppercase;
  opacity: 0.78;
}

#prices .currency-switcher {
  display: grid;
  grid-template-columns: repeat(5, minmax(0, 1fr));
  width: 100%;
  max-width: 520px;
  border: 1px solid rgba(243, 239, 229, 0.46);
  background: rgba(45, 45, 45, 0.12);
}

#prices .currency-button {
  min-height: 46px;
  padding: 9px 12px;
  border: 0;
  border-right: 1px solid rgba(243, 239, 229, 0.34);
  border-radius: 0;
  background: transparent;
  color: var(--paper);
  font: inherit;
  font-size: 13px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.08em;
  cursor: pointer;
  transition: background-color 150ms ease, color 150ms ease, transform 150ms ease;
}

#prices .currency-button:last-child {
  border-right: 0;
}

#prices .currency-button:hover,
#prices .currency-button:focus-visible {
  background: rgba(243, 239, 229, 0.12);
}

#prices .currency-button.is-active {
  background: var(--paper);
  color: var(--dark);
}

#prices .currency-note {
  display: block;
  max-width: 520px;
  color: var(--paper);
  font-size: 12px;
  font-weight: 650;
  line-height: 1.4;
  opacity: 0.66;
}

#prices .price {
  display: flex;
  flex-wrap: wrap;
  align-items: baseline;
  gap: 9px;
  text-transform: none;
}

#prices .price-prefix {
  color: currentColor;
  font-family: var(--tfac-font-body);
  font-size: clamp(13px, 1.05vw, 16px);
  font-weight: 800;
  line-height: 1;
  letter-spacing: 0.02em;
  text-transform: lowercase;
  opacity: 0.72;
}

#prices .price-value {
  display: inline-block;
  color: currentColor;
  font-family: var(--tfac-font-head);
  font-size: clamp(38px, 4vw, 62px);
  font-weight: 950;
  line-height: 0.86;
  letter-spacing: -0.075em;
  white-space: nowrap;
  transition: opacity 120ms ease, transform 120ms ease;
}

#prices .price-card:not(.featured) .price {
  color: var(--paper);
}

#prices .price-card.featured .price {
  color: var(--paper);
}

@media (max-width: 880px) {
  #prices .price-section-head {
    gap: 28px;
  }

  #prices .price-section-intro {
    width: 100%;
  }

  #prices .currency-switcher,
  #prices .currency-note {
    max-width: none;
  }
}

@media (max-width: 560px) {
  #prices .currency-control {
    margin-top: 2px;
  }

  #prices .currency-switcher {
    display: flex;
    max-width: 100%;
    overflow-x: auto;
    scrollbar-width: none;
    -webkit-overflow-scrolling: touch;
  }

  #prices .currency-switcher::-webkit-scrollbar {
    display: none;
  }

  #prices .currency-button {
    flex: 0 0 70px;
    min-height: 44px;
  }

  #prices .currency-note {
    font-size: 11px;
  }

  #prices .price {
    margin: 22px 0;
  }

  #prices .price-value {
    font-size: clamp(36px, 12vw, 52px);
  }
}

@media (prefers-reduced-motion: reduce) {
  #prices .currency-button,
  #prices .price-value {
    transition: none;
  }
}


/* 1.15.2 — market-aligned pricing and scope notes. */
#prices .pricing-terms {
  display: grid;
  grid-template-columns: minmax(0, 1.4fr) minmax(280px, 0.8fr);
  gap: 18px;
  margin-top: 28px;
}

#prices .pricing-disclaimer,
#prices .pricing-social-note {
  margin: 0;
  padding: 18px 20px;
  border: 1px solid rgba(243, 239, 229, 0.22);
  border-radius: 18px;
  color: var(--paper);
  font-size: 14px;
  font-weight: 650;
  line-height: 1.5;
}

#prices .pricing-disclaimer {
  background: rgba(243, 239, 229, 0.06);
}

#prices .pricing-social-note {
  background: var(--paper);
  color: var(--dark);
  font-weight: 800;
}

@media (max-width: 820px) {
  #prices .pricing-terms {
    grid-template-columns: 1fr;
    margin-top: 22px;
  }
}

@media (max-width: 700px) {
  #prices .pricing-disclaimer,
  #prices .pricing-social-note {
    padding: 15px 16px;
    border-radius: 15px;
    font-size: 13px;
  }
}


/* 1.15.3 — pricing-card contrast fix. */
#prices .price-card:not(.featured) .price,
#prices .price-card:not(.featured) .price-prefix,
#prices .price-card:not(.featured) .price-value {
  color: var(--acid) !important;
  opacity: 1;
}

#prices .price-card:not(.featured) .price-top > span {
  background: var(--ink);
  border-color: var(--ink);
  color: var(--paper) !important;
}

#prices .price-card.featured .price-top > span {
  background: var(--ink);
  border-color: var(--ink);
  color: var(--paper) !important;
}

#prices .price-card .price {
  min-height: 64px;
}

@media (max-width: 760px) {
  #prices .price-card .price {
    min-height: 50px;
  }
}


/* 1.15.4 — clean pricing header and compact currency switcher. */
#prices .price-section-head {
  display: block;
  margin-bottom: 32px;
}

#prices .price-section-head .eyebrow {
  margin-bottom: 16px;
}

#prices .price-heading-row {
  display: flex;
  align-items: flex-end;
  justify-content: space-between;
  gap: 28px;
}

#prices .price-heading-row h2 {
  max-width: 980px;
  margin: 0;
}

#prices .currency-control {
  display: block;
  flex: 0 0 auto;
  width: auto;
}

#prices .currency-switcher {
  display: inline-flex;
  width: auto;
  max-width: none;
  padding: 4px;
  gap: 4px;
  border: 1px solid rgba(243, 239, 229, 0.34);
  border-radius: 999px;
  background: rgba(243, 239, 229, 0.05);
}

#prices .currency-button {
  min-width: 54px;
  min-height: 38px;
  padding: 8px 12px;
  border: 0;
  border-radius: 999px;
  color: rgba(243, 239, 229, 0.72);
  font-size: 12px;
  letter-spacing: 0.06em;
}

#prices .currency-button:last-child {
  border-right: 0;
}

#prices .currency-button:hover,
#prices .currency-button:focus-visible {
  background: rgba(243, 239, 229, 0.1);
  color: var(--paper);
}

#prices .currency-button.is-active {
  background: var(--paper);
  color: var(--ink);
}

#prices .currency-label,
#prices .currency-note,
#prices .price-section-intro {
  display: none !important;
}

@media (max-width: 920px) {
  #prices .price-heading-row {
    align-items: flex-start;
    flex-direction: column;
    gap: 20px;
  }
}

@media (max-width: 560px) {
  #prices .price-section-head {
    margin-bottom: 24px;
  }

  #prices .price-heading-row {
    gap: 16px;
  }

  #prices .currency-control {
    width: 100%;
  }

  #prices .currency-switcher {
    display: grid;
    grid-template-columns: repeat(5, minmax(0, 1fr));
    width: 100%;
    overflow: visible;
  }

  #prices .currency-button {
    min-width: 0;
    min-height: 38px;
    padding-inline: 6px;
    font-size: 11px;
  }
}


/* 1.15.5 — net pricing labels and non-binding price information. */
#prices .price-net-label {
  display: inline-flex;
  align-items: center;
  min-height: 24px;
  padding: 4px 8px;
  border: 1px solid currentColor;
  border-radius: 999px;
  color: currentColor;
  font-family: var(--tfac-font-body);
  font-size: 10px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.08em;
  text-transform: uppercase;
  opacity: 0.72;
  transform: translateY(-2px);
}

#prices .price-card:not(.featured) .price-net-label {
  color: var(--acid);
}

#prices .price-card.featured .price-net-label {
  color: var(--paper);
}

#prices .pricing-legal {
  display: grid;
  grid-template-columns: minmax(0, 0.75fr) minmax(0, 1.25fr);
  gap: 14px;
  margin-top: 22px;
}

#prices .pricing-tax-note,
#prices .pricing-legal-note {
  margin: 0;
  padding: 13px 15px;
  border-top: 1px solid rgba(243, 239, 229, 0.28);
  color: rgba(243, 239, 229, 0.74);
  font-size: 11px;
  font-weight: 650;
  line-height: 1.45;
}

#prices .pricing-tax-note {
  font-weight: 850;
  color: var(--paper);
}

#prices .pricing-terms {
  margin-top: 16px;
}

@media (max-width: 820px) {
  #prices .pricing-legal {
    grid-template-columns: 1fr;
    gap: 0;
  }

  #prices .pricing-tax-note,
  #prices .pricing-legal-note {
    padding-inline: 0;
  }
}

@media (max-width: 560px) {
  #prices .price-net-label {
    min-height: 22px;
    padding: 4px 7px;
    font-size: 9px;
  }

  #prices .pricing-legal {
    margin-top: 18px;
  }

  #prices .pricing-tax-note,
  #prices .pricing-legal-note {
    font-size: 10.5px;
  }
}


/* 1.15.6 — compact and balanced "How do we start?" section. */
#start {
  padding: 64px 0 72px;
}

#start .section-head {
  display: block;
  margin-bottom: 32px;
}

#start .section-head > div {
  width: 100%;
}

#start .section-head h2 {
  max-width: 980px;
  font-size: clamp(48px, 5vw, 76px);
  line-height: 0.9;
  letter-spacing: -0.065em;
}

#start .section-head .lead {
  max-width: 760px;
  margin-top: 18px;
  color: var(--muted);
  font-size: clamp(18px, 1.35vw, 22px);
  font-weight: 700;
  line-height: 1.38;
}

#start .steps {
  grid-template-columns: repeat(4, minmax(0, 1fr));
  gap: 14px;
  border: 0;
}

#start .step {
  min-height: 286px;
  padding: 26px 24px 28px;
  border: 2px solid var(--ink);
  background: var(--paper);
}

#start .step:nth-child(2) {
  background: var(--ink);
  color: var(--paper);
}

#start .step:nth-child(3) {
  background: var(--acid);
  color: var(--paper);
}

#start .step span {
  width: 44px;
  height: 44px;
  margin-bottom: 30px;
  border: 0;
  background: var(--ink);
  color: var(--paper);
  font-size: 12px;
}

#start .step:nth-child(2) span,
#start .step:nth-child(3) span {
  background: var(--paper);
  color: var(--ink);
}

#start .step h3 {
  max-width: 290px;
  font-size: clamp(27px, 2.15vw, 36px);
  line-height: 0.96;
  letter-spacing: -0.055em;
  hyphens: none;
  text-wrap: balance;
}

#start .step p {
  max-width: 300px;
  margin-top: auto;
  padding-top: 24px;
  color: var(--ink);
  font-size: 16px;
  font-weight: 700;
  line-height: 1.42;
}

#start .step:nth-child(2) h3,
#start .step:nth-child(2) p,
#start .step:nth-child(3) h3,
#start .step:nth-child(3) p {
  color: var(--paper);
}

@media (max-width: 1050px) {
  #start .steps {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }

  #start .step {
    min-height: 250px;
  }
}

@media (max-width: 700px) {
  #start {
    padding: 48px 0 54px;
  }

  #start .section-head {
    margin-bottom: 24px;
  }

  #start .section-head h2 {
    font-size: clamp(38px, 11vw, 52px) !important;
    line-height: 0.92;
  }

  #start .section-head .lead {
    margin-top: 14px;
    font-size: 16px;
    line-height: 1.45;
  }

  #start .steps {
    grid-template-columns: 1fr;
    gap: 10px;
  }

  #start .step {
    min-height: 0;
    padding: 22px 20px 24px;
  }

  #start .step span {
    width: 40px;
    height: 40px;
    margin-bottom: 22px;
  }

  #start .step h3 {
    max-width: none;
    font-size: clamp(28px, 8.4vw, 36px);
  }

  #start .step p {
    max-width: none;
    margin-top: 16px;
    padding-top: 0;
    font-size: 15px;
  }
}


/* 1.15.8 — display-heading system restored to the approved visual direction. */
:where(
  .hero-display,
  .section h2,
  .directions-copy h2,
  .manifesto-left h2,
  .problem-title-card h2,
  .about-copy h2,
  .trusted-heading h2,
  .faq-grid h2,
  .contact-copy h2,
  .page-content h1,
  .content-area h1,
  .legal-page-hero h1
) {
  font-family: var(--tfac-font-head) !important;
  font-weight: 950 !important;
  font-style: normal;
  font-synthesis: none;
  font-kerning: normal;
  text-transform: uppercase;
  letter-spacing: -0.075em !important;
  line-height: 0.86 !important;
  text-wrap: balance;
}

/* Hero: light first line + approved burgundy second line. */
.agency-hero .hero-display {
  max-width: 1160px;
  margin-bottom: 22px;
  line-height: 0.84 !important;
  letter-spacing: -0.082em !important;
}

.agency-hero .hero-display-top {
  color: var(--paper) !important;
  font-family: var(--tfac-font-head) !important;
  font-size: clamp(68px, 7.6vw, 114px) !important;
  font-weight: 950 !important;
  line-height: 0.84 !important;
  letter-spacing: -0.082em !important;
}

.agency-hero .hero-display-bottom {
  display: block !important;
  margin-top: 8px !important;
  color: var(--acid) !important;
  font-family: var(--tfac-font-head) !important;
  font-size: clamp(64px, 7.1vw, 106px) !important;
  font-weight: 950 !important;
  line-height: 0.84 !important;
  letter-spacing: -0.082em !important;
  -webkit-text-stroke: 0 !important;
  text-shadow: none !important;
}

/* Large section headings like the approved reference. */
.section h2,
.directions-copy h2,
.manifesto-left h2,
.about-copy h2,
.trusted-heading h2,
.faq-grid h2,
.contact-copy h2,
#prices .price-heading-row h2,
#start .section-head h2 {
  max-width: 1120px;
  font-size: clamp(52px, 5.15vw, 96px) !important;
  line-height: 0.86 !important;
  letter-spacing: -0.075em !important;
}

.problem-title-card h2 {
  font-size: clamp(48px, 4.7vw, 84px) !important;
}

/* Card titles follow the same typography without becoming oversized. */
.audience-card h3,
.case-card h3,
.price-card h3,
.step h3,
.ecosystem-card h3,
.service-main h3,
.contact-box h3,
.article-card h2,
.article-card h3 {
  font-family: var(--tfac-font-head) !important;
  font-weight: 950 !important;
  font-style: normal;
  font-synthesis: none;
  text-transform: uppercase;
  line-height: 0.9 !important;
  letter-spacing: -0.06em !important;
}

.audience-card h3,
.case-card h3,
.price-card h3,
.step h3,
.ecosystem-card h3 {
  font-size: clamp(34px, 3vw, 54px) !important;
}

/* Keep headings clean and left aligned across all languages. */
.section-head,
.price-section-head {
  text-align: left;
}

@media (max-width: 1180px) {
  .agency-hero .hero-display-top {
    font-size: clamp(56px, 8.2vw, 88px) !important;
  }

  .agency-hero .hero-display-bottom {
    font-size: clamp(52px, 7.7vw, 82px) !important;
  }

  .section h2,
  .directions-copy h2,
  .manifesto-left h2,
  .about-copy h2,
  .trusted-heading h2,
  .faq-grid h2,
  .contact-copy h2,
  #prices .price-heading-row h2,
  #start .section-head h2 {
    font-size: clamp(46px, 6vw, 76px) !important;
  }
}

@media (max-width: 700px) {
  :where(
    .hero-display,
    .section h2,
    .directions-copy h2,
    .manifesto-left h2,
    .problem-title-card h2,
    .about-copy h2,
    .trusted-heading h2,
    .faq-grid h2,
    .contact-copy h2
  ) {
    letter-spacing: -0.06em !important;
    line-height: 0.88 !important;
    text-wrap: pretty;
  }

  .agency-hero .hero-display {
    margin-bottom: 20px;
    line-height: 0.88 !important;
  }

  .agency-hero .hero-display-top {
    font-size: clamp(42px, 12.9vw, 58px) !important;
    line-height: 0.88 !important;
    letter-spacing: -0.065em !important;
  }

  .agency-hero .hero-display-bottom {
    margin-top: 5px !important;
    font-size: clamp(40px, 12.1vw, 55px) !important;
    line-height: 0.88 !important;
    letter-spacing: -0.065em !important;
  }

  .section h2,
  .directions-copy h2,
  .manifesto-left h2,
  .about-copy h2,
  .trusted-heading h2,
  .faq-grid h2,
  .contact-copy h2,
  #prices .price-heading-row h2,
  #start .section-head h2 {
    font-size: clamp(40px, 11.4vw, 54px) !important;
    line-height: 0.88 !important;
  }

  .problem-title-card h2 {
    font-size: clamp(38px, 10.8vw, 50px) !important;
  }

  .audience-card h3,
  .case-card h3,
  .price-card h3,
  .step h3,
  .ecosystem-card h3 {
    font-size: clamp(30px, 8.6vw, 42px) !important;
    line-height: 0.9 !important;
  }
}

/* 1.15.9 — configurable social profiles in contact, footer and Schema sameAs. */
.footer-social-block,
.contact-social-block {
  display: grid;
  gap: 12px;
}

.footer-social-block {
  margin-top: 24px;
}

.contact-social-block {
  margin-top: 22px;
  padding-top: 20px;
  border-top: 1px solid rgba(243, 239, 229, 0.22);
}

.footer-social-label,
.contact-social-label {
  color: rgba(243, 239, 229, 0.64);
  font-size: 11px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

.social-links {
  display: flex;
  flex-wrap: wrap;
  gap: 8px;
}

.social-link {
  display: inline-flex;
  align-items: center;
  gap: 9px;
  min-height: 42px;
  padding: 9px 12px;
  border: 1px solid rgba(243, 239, 229, 0.22);
  border-radius: 999px;
  background: transparent;
  color: var(--paper) !important;
  font-size: 12px;
  font-weight: 850;
  line-height: 1;
  text-decoration: none !important;
  transition:
    background-color 160ms ease,
    border-color 160ms ease,
    color 160ms ease,
    transform 160ms ease;
}

.social-link:hover,
.social-link:focus-visible {
  border-color: var(--acid);
  background: var(--acid);
  color: var(--paper) !important;
  transform: translateY(-2px);
}

.social-link-icon {
  display: grid;
  place-items: center;
  flex: 0 0 auto;
  width: 20px;
  height: 20px;
}

.social-link-icon svg {
  display: block;
  width: 20px;
  height: 20px;
  overflow: visible;
  fill: currentColor;
  stroke: none;
}

.social-link--instagram .social-link-icon svg rect,
.social-link--instagram .social-link-icon svg circle:not(.social-icon-fill) {
  fill: none;
  stroke: currentColor;
  stroke-width: 1.8;
}

.social-link--instagram .social-link-icon .social-icon-fill {
  fill: currentColor;
  stroke: none;
}

.social-link--youtube .social-icon-fill {
  fill: var(--dark);
}

.social-link-label {
  white-space: nowrap;
}

.social-link-arrow {
  margin-left: 2px;
  opacity: 0.58;
  font-size: 11px;
}

.site-footer .social-links--footer {
  max-width: 760px;
}

.contact-box .social-links--contact {
  gap: 7px;
}

.contact-box .social-link {
  min-height: 40px;
  padding: 8px 11px;
  border-color: rgba(243, 239, 229, 0.3);
}

@media (max-width: 640px) {
  .footer-social-block {
    margin-top: 20px;
  }

  .social-links {
    gap: 7px;
  }

  .social-link {
    min-height: 40px;
    padding: 8px 11px;
    font-size: 11px;
  }

  .social-link-icon,
  .social-link-icon svg {
    width: 18px;
    height: 18px;
  }
}

@media (prefers-reduced-motion: reduce) {
  .social-link {
    transition: none;
  }
}


/* 1.16.0 — consistent content alignment and calibrated heading scale. */
.section {
  padding-block: clamp(58px, 5.6vw, 78px);
}

.section .eyebrow {
  margin-bottom: 14px;
}

.section h2,
.directions-copy h2,
.manifesto-left h2,
.problem-title-card h2,
.about-copy h2,
.trusted-heading h2,
.faq-grid h2,
.contact-copy h2 {
  width: auto;
  margin-inline: 0;
  text-align: left;
  overflow-wrap: normal;
  word-break: normal;
  hyphens: none;
}

.section-head {
  grid-template-columns: minmax(0, 1.18fr) minmax(300px, 0.68fr);
  gap: clamp(28px, 4.8vw, 68px);
  align-items: end;
  margin-bottom: clamp(30px, 3.8vw, 46px);
  text-align: left;
}

.section-head > div,
.section-head > .lead,
.price-heading-row > *,
.intro-grid > *,
.directions-grid > *,
.manifesto-grid > *,
.problem-grid > *,
.about-grid > *,
.faq-grid > *,
.form-wrap > * {
  min-width: 0;
}

.section-head > .lead {
  justify-self: end;
  width: 100%;
  max-width: 560px;
  margin: 0 0 4px;
}

/* Split sections: wider text columns prevent forced, oversized line breaks. */
#directions .directions-grid {
  grid-template-columns: minmax(0, 0.88fr) minmax(420px, 1.12fr);
  gap: clamp(40px, 5.2vw, 72px);
  align-items: center;
}

.problem-section .problem-grid {
  grid-template-columns: minmax(340px, 0.78fr) minmax(0, 1.22fr);
  gap: clamp(34px, 4.8vw, 66px);
  align-items: stretch;
}

.manifesto-section .manifesto-grid {
  grid-template-columns: minmax(0, 1.04fr) minmax(360px, 0.86fr);
  gap: clamp(38px, 5vw, 70px);
  align-items: center;
}

#about .about-grid,
#faq .faq-grid,
#contact .form-wrap {
  grid-template-columns: minmax(0, 0.9fr) minmax(420px, 1.1fr);
  gap: clamp(42px, 5.4vw, 76px);
  align-items: start;
}

#who .intro-grid {
  margin-bottom: 34px;
}

#who .intro-grid .lead {
  max-width: 860px;
  margin-top: 20px;
}

/* Section-specific headline sizes: strong, but no longer uniformly oversized. */
#who h2 {
  max-width: 880px;
  font-size: clamp(46px, 4.35vw, 72px) !important;
}

#services h2 {
  max-width: 900px;
  font-size: clamp(48px, 4.55vw, 76px) !important;
}

#directions h2 {
  max-width: 650px;
  font-size: clamp(43px, 4vw, 66px) !important;
}

.problem-title-card h2 {
  max-width: 520px;
  font-size: clamp(40px, 3.55vw, 58px) !important;
  line-height: 0.9 !important;
}

.manifesto-section h2 {
  max-width: 760px;
  font-size: clamp(44px, 4.15vw, 68px) !important;
}

#cases h2,
#ecosystem h2 {
  max-width: 760px;
  font-size: clamp(44px, 4vw, 66px) !important;
}

#prices .price-heading-row h2 {
  max-width: 760px;
  font-size: clamp(46px, 4.35vw, 72px) !important;
}

#about .about-copy h2 {
  max-width: 680px;
  font-size: clamp(42px, 3.8vw, 62px) !important;
}

#trusted .trusted-heading h2 {
  max-width: 620px;
  font-size: clamp(40px, 3.45vw, 56px) !important;
  line-height: 0.91 !important;
}

#start .section-head h2 {
  max-width: 820px;
  font-size: clamp(46px, 4.25vw, 70px) !important;
}

#faq .faq-grid h2 {
  max-width: 610px;
  font-size: clamp(39px, 3.4vw, 55px) !important;
  line-height: 0.91 !important;
}

#contact .contact-copy h2 {
  max-width: 720px;
  font-size: clamp(42px, 3.7vw, 61px) !important;
  line-height: 0.9 !important;
}

/* Card typography: consistent hierarchy and aligned content. */
.audience-card h3,
.case-card h3,
.price-card h3 {
  font-size: clamp(28px, 2.35vw, 40px) !important;
  line-height: 0.94 !important;
}

.ecosystem-card h3 {
  font-size: clamp(25px, 2vw, 34px) !important;
  line-height: 0.96 !important;
}

#start .step h3 {
  font-size: clamp(27px, 2vw, 35px) !important;
  line-height: 0.95 !important;
}

.service-main h3 {
  font-size: clamp(32px, 3.1vw, 48px) !important;
  line-height: 0.94 !important;
}

.contact-box h3 {
  font-size: clamp(25px, 2.35vw, 38px) !important;
  line-height: 0.94 !important;
}

.audience-card,
.case-card,
.price-card,
.step,
.ecosystem-card {
  min-width: 0;
}

.audience-card h3,
.case-card h3,
.price-card h3,
.step h3,
.ecosystem-card h3 {
  max-width: 100%;
}

#prices .price-card h3 {
  min-height: 1.88em;
}

#prices .price-card .price {
  margin-block: 22px 26px;
}

#prices .price-card ul {
  margin-top: auto;
}

#cases .case-card h3 {
  min-height: 1.9em;
}

/* Content measure and baseline alignment. */
.directions-copy .lead,
.manifesto-left .lead,
.about-copy .lead,
.contact-copy .lead,
#faq .faq-grid > div:first-child .lead {
  max-width: 720px;
  margin-top: 20px;
}

#trusted .trusted-head {
  grid-template-columns: minmax(0, 0.9fr) minmax(320px, 0.72fr);
  gap: clamp(30px, 5vw, 76px);
  align-items: end;
}

#trusted .trusted-intro .lead {
  justify-self: end;
  max-width: 540px;
}

@media (max-width: 1080px) {
  .section-head,
  #directions .directions-grid,
  .problem-section .problem-grid,
  .manifesto-section .manifesto-grid,
  #about .about-grid,
  #faq .faq-grid,
  #contact .form-wrap,
  #trusted .trusted-head {
    grid-template-columns: 1fr;
  }

  .section-head,
  #trusted .trusted-head {
    gap: 22px;
    align-items: start;
  }

  .section-head > .lead,
  #trusted .trusted-intro .lead {
    justify-self: start;
    max-width: 820px;
    margin: 0;
  }

  #directions .directions-grid,
  .problem-section .problem-grid,
  .manifesto-section .manifesto-grid,
  #about .about-grid,
  #faq .faq-grid,
  #contact .form-wrap {
    gap: 34px;
  }

  #prices .price-heading-row {
    align-items: flex-start;
  }
}

@media (max-width: 700px) {
  .section {
    padding-block: 46px;
  }

  .section .eyebrow {
    margin-bottom: 12px;
  }

  .section-head {
    margin-bottom: 26px;
  }

  #who h2,
  #services h2,
  #directions h2,
  .problem-title-card h2,
  .manifesto-section h2,
  #cases h2,
  #ecosystem h2,
  #prices .price-heading-row h2,
  #about .about-copy h2,
  #trusted .trusted-heading h2,
  #start .section-head h2,
  #faq .faq-grid h2,
  #contact .contact-copy h2 {
    max-width: 100%;
    letter-spacing: -0.055em !important;
    line-height: 0.91 !important;
  }

  #who h2,
  #services h2,
  #prices .price-heading-row h2,
  #start .section-head h2 {
    font-size: clamp(38px, 10.5vw, 48px) !important;
  }

  #directions h2,
  .manifesto-section h2,
  #cases h2,
  #ecosystem h2,
  #about .about-copy h2,
  #contact .contact-copy h2 {
    font-size: clamp(36px, 9.8vw, 45px) !important;
  }

  .problem-title-card h2,
  #trusted .trusted-heading h2,
  #faq .faq-grid h2 {
    font-size: clamp(34px, 9.2vw, 42px) !important;
  }

  .audience-card h3,
  .case-card h3,
  .price-card h3 {
    font-size: clamp(27px, 7.7vw, 36px) !important;
  }

  .ecosystem-card h3,
  #start .step h3 {
    font-size: clamp(25px, 7.1vw, 33px) !important;
  }

  .service-main h3 {
    font-size: clamp(29px, 8.2vw, 39px) !important;
  }

  #prices .price-card h3,
  #cases .case-card h3 {
    min-height: 0;
  }

  .directions-copy .lead,
  .manifesto-left .lead,
  .about-copy .lead,
  .contact-copy .lead,
  #faq .faq-grid > div:first-child .lead {
    margin-top: 16px;
  }
}


/* 1.16.1 — remove duplicated contact card and keep the contact section focused on the form. */
#contact .form-wrap {
  grid-template-columns: minmax(300px, 0.72fr) minmax(520px, 1.28fr);
  align-items: start;
}

#contact .contact-copy {
  position: sticky;
  top: 120px;
}

#contact .contact-copy .lead {
  max-width: 560px;
}

@media (max-width: 1080px) {
  #contact .form-wrap {
    grid-template-columns: 1fr;
  }

  #contact .contact-copy {
    position: static;
  }
}

@media (max-width: 700px) {
  #contact .form-wrap {
    gap: 26px;
  }
}

/* 1.16.2 — complete mobile layout pass: rhythm, headings, cards, forms and footer. */
@media (max-width: 760px) {
  html,
  body {
    max-width: 100%;
    overflow-x: clip;
  }

  body {
    -webkit-text-size-adjust: 100%;
  }

  .container,
  .site-header .container {
    width: calc(100% - 28px);
    max-width: none;
  }

  /* Header: keep all controls inside narrow screens without crushing the logo. */
  .header-inner {
    min-width: 0;
    height: 64px;
    gap: 7px;
  }

  .brand {
    flex: 1 1 auto;
    width: auto;
    max-width: 142px;
    min-width: 0;
  }

  .brand-logo,
  .brand-logo img {
    width: auto;
    max-width: 142px;
    max-height: 46px;
  }

  .lang-switch {
    flex: 0 0 auto;
    margin-left: auto;
  }

  .lang-switch a {
    min-width: 31px;
    height: 38px;
    padding: 0 6px;
    font-size: 9px;
  }

  .menu-toggle {
    flex: 0 0 40px;
    width: 40px;
    height: 40px;
    font-size: 20px;
  }

  .main-nav {
    top: calc(64px + env(safe-area-inset-top));
    left: 14px;
    right: 14px;
    max-height: calc(100dvh - 82px - env(safe-area-inset-top));
    overflow-y: auto;
    overscroll-behavior: contain;
    box-shadow: 8px 8px 0 rgba(45, 45, 45, 0.16);
  }

  .main-nav a {
    min-height: 50px;
    padding-inline: 16px;
    font-size: 12px;
  }

  /* Hero: retain the bold display style without filling the whole phone screen. */
  .agency-hero {
    padding: 26px 0 34px;
  }

  .hero-copy {
    min-width: 0;
  }

  .hero-badges {
    gap: 6px;
    margin-bottom: 20px;
  }

  .hero-badges span,
  .hero-badges span:nth-child(2n),
  .hero-badges span:nth-last-child(-n + 2) {
    min-height: 32px;
    padding-inline: 11px;
    font-size: 9px;
  }

  .agency-hero .eyebrow {
    margin-bottom: 13px;
    font-size: 10px;
  }

  .hero-display {
    margin-bottom: 18px;
  }

  .hero-display-top {
    font-size: clamp(39px, 11.6vw, 49px);
    line-height: 0.91;
  }

  .hero-display-bottom {
    margin-top: 4px;
    font-size: clamp(37px, 10.9vw, 47px);
    line-height: 0.91;
  }

  .hero-lead {
    font-size: 16px;
    line-height: 1.48;
  }

  .hero-actions {
    margin-top: 21px;
  }

  .hero-actions .btn {
    min-height: 52px;
    padding: 11px 14px;
    font-size: 11px;
  }

  .hero-note {
    margin-top: 18px;
    font-size: 14px;
    line-height: 1.44;
  }

  .ticker-track span {
    min-height: 42px;
    padding-inline: 18px;
    font-size: 11px;
  }

  /* Global mobile rhythm and readable text measure. */
  .section {
    padding-block: 42px;
  }

  .section-head,
  #trusted .trusted-head {
    gap: 16px;
    margin-bottom: 24px;
  }

  .section .eyebrow {
    margin-bottom: 10px;
    font-size: 10px;
    letter-spacing: 0.14em;
  }

  .lead,
  .section-head > .lead,
  #trusted .trusted-intro .lead,
  .directions-copy .lead,
  .manifesto-left .lead,
  .about-copy .lead,
  .contact-copy .lead,
  #faq .faq-grid > div:first-child .lead {
    max-width: 100%;
    margin-top: 14px;
    font-size: 16px;
    line-height: 1.48;
  }

  /* Section-specific mobile heading scale. */
  #who h2,
  #services h2,
  #prices .price-heading-row h2,
  #start .section-head h2 {
    font-size: clamp(34px, 9.2vw, 40px) !important;
  }

  #directions h2,
  .manifesto-section h2,
  #cases h2,
  #ecosystem h2,
  #about .about-copy h2,
  #contact .contact-copy h2 {
    font-size: clamp(32px, 8.7vw, 38px) !important;
  }

  .problem-title-card h2,
  #trusted .trusted-heading h2,
  #faq .faq-grid h2 {
    font-size: clamp(30px, 8.1vw, 36px) !important;
  }

  #who h2,
  #services h2,
  #directions h2,
  .problem-title-card h2,
  .manifesto-section h2,
  #cases h2,
  #ecosystem h2,
  #prices .price-heading-row h2,
  #about .about-copy h2,
  #trusted .trusted-heading h2,
  #start .section-head h2,
  #faq .faq-grid h2,
  #contact .contact-copy h2 {
    line-height: 0.94 !important;
    letter-spacing: -0.048em !important;
    text-wrap: balance;
  }

  /* Cards: remove artificial heights and oversized internal typography. */
  .audience-grid,
  .case-grid,
  .price-grid,
  .steps,
  .ecosystem-grid,
  .cards {
    grid-template-columns: 1fr;
  }

  .audience-card,
  .case-card,
  .price-card,
  .step,
  .ecosystem-card,
  .card-3d,
  .card {
    min-height: 0;
    padding: 20px;
  }

  .card-index,
  .service-no,
  .problem-icon,
  .ecosystem-card span,
  .step span,
  .price-top > span {
    width: 38px;
    height: 38px;
    margin-bottom: 18px;
    font-size: 11px;
  }

  .audience-card h3,
  .case-card h3,
  .price-card h3 {
    font-size: clamp(25px, 7vw, 30px) !important;
    line-height: 0.97 !important;
  }

  .ecosystem-card h3,
  #start .step h3 {
    font-size: clamp(23px, 6.5vw, 28px) !important;
    line-height: 0.98 !important;
  }

  .audience-card p,
  .case-card p,
  .price-card li,
  .step p,
  .ecosystem-card p {
    margin-top: 13px;
    font-size: 15px;
    line-height: 1.45;
  }

  .audience-card strong {
    padding-top: 20px;
    font-size: 13px;
  }

  /* Services: compact two-column row, with tag below the copy. */
  .service-row {
    grid-template-columns: 38px minmax(0, 1fr);
    gap: 13px;
    padding-block: 20px;
  }

  .service-no {
    margin: 0;
  }

  .service-main h3 {
    font-size: clamp(26px, 7.4vw, 32px) !important;
    line-height: 0.97 !important;
  }

  .service-main p {
    margin-top: 9px;
    font-size: 15px;
    line-height: 1.44;
  }

  .service-tag {
    grid-column: 2;
    width: max-content;
    max-width: 100%;
    min-height: 36px;
    padding-inline: 12px;
    justify-content: flex-start;
    white-space: normal;
    font-size: 10px;
  }

  /* Direction chips: compact grid instead of ten full-width rows. */
  #directions .directions-grid,
  .problem-section .problem-grid,
  .manifesto-section .manifesto-grid,
  #about .about-grid,
  #faq .faq-grid,
  #contact .form-wrap {
    gap: 26px;
  }

  .directions-sticker {
    margin-top: 24px;
    padding: 14px 16px;
    font-size: clamp(22px, 6.4vw, 28px);
  }

  .direction-wall {
    display: grid;
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 7px;
    min-height: 0;
    padding: 12px;
  }

  .direction-chip {
    width: auto;
    min-width: 0;
    min-height: 42px;
    padding: 8px 10px;
    justify-content: flex-start;
    font-size: 11px;
    line-height: 1.2;
    overflow-wrap: anywhere;
  }

  .direction-chip::before {
    margin-right: 5px;
  }

  /* Problem and manifesto sections. */
  .problem-title-card {
    min-height: 0;
    padding: 22px;
  }

  .problem-title-card p {
    margin-top: 16px;
    font-size: 16px;
  }

  .problem-item {
    grid-template-columns: 38px minmax(0, 1fr);
    gap: 13px;
    padding-block: 18px;
  }

  .problem-item b {
    font-size: clamp(20px, 5.7vw, 24px);
    line-height: 1.02;
  }

  .problem-item span {
    margin-top: 6px;
    font-size: 14px;
    line-height: 1.42;
  }

  .manifesto-questions {
    grid-template-columns: 1fr;
  }

  .question-bubble {
    min-height: 0;
    padding: 20px;
    font-size: clamp(22px, 6.2vw, 28px);
    line-height: 1;
  }

  /* Cases, prices and process. */
  .case-label {
    margin-bottom: 17px;
  }

  .case-metric {
    margin-top: 18px;
    font-size: clamp(38px, 11vw, 50px);
  }

  #prices .price-heading-row {
    display: grid;
    grid-template-columns: 1fr;
    gap: 17px;
  }

  .currency-control {
    width: 100%;
    max-width: 100%;
  }

  .currency-switcher {
    width: 100%;
    display: grid;
    grid-template-columns: repeat(5, minmax(0, 1fr));
    overflow: hidden;
  }

  .currency-button {
    min-width: 0;
    min-height: 42px;
    padding-inline: 4px;
    font-size: 10px;
  }

  .price-card {
    min-height: 0;
  }

  .price-top {
    gap: 13px;
  }

  #prices .price-card h3,
  #cases .case-card h3 {
    min-height: 0;
  }

  #prices .price-card .price {
    margin-block: 18px 20px;
  }

  .price {
    font-size: clamp(38px, 11vw, 50px);
  }

  .price-prefix,
  .price-net-label {
    font-size: 11px;
  }

  .pricing-legal,
  .pricing-terms {
    margin-top: 20px;
    padding: 16px;
  }

  .pricing-legal p,
  .pricing-terms p {
    font-size: 12px;
    line-height: 1.45;
  }

  #start .steps {
    grid-template-columns: 1fr;
  }

  #start .step {
    min-height: 0;
  }

  /* About, trust and FAQ. */
  #about .about-proof {
    width: 100%;
    margin: 0;
    padding: 22px 16px 24px;
  }

  #about .about-facts li,
  #about .about-facts li:nth-child(2),
  #about .about-facts li:nth-child(3) {
    grid-template-columns: 40px minmax(0, 1fr);
    gap: 12px;
    padding: 16px 34px 16px 14px;
  }

  #about .about-facts li > span:last-child {
    padding-left: 12px;
    font-size: 15px;
  }

  #trusted .trusted-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 8px;
  }

  #trusted .trusted-card {
    min-height: 132px;
  }

  #trusted .trusted-logo-link {
    padding: 12px;
  }

  .faq-item summary {
    padding-block: 18px;
    font-size: clamp(20px, 5.7vw, 24px);
    line-height: 1.03;
  }

  .faq-item p {
    padding: 0 0 18px 25px;
    font-size: 15px;
    line-height: 1.5;
  }

  /* Contact form: one clean column with touch-friendly fields. */
  #contact .form-wrap {
    gap: 22px;
  }

  .contact-card {
    padding: 18px;
  }

  .field-grid {
    grid-template-columns: 1fr;
    gap: 13px;
  }

  .lead-form {
    gap: 13px;
  }

  .form-field {
    gap: 7px;
  }

  .form-field label {
    font-size: 11px;
  }

  .form-field input,
  .form-field select,
  .form-field textarea {
    min-height: 50px;
    padding: 12px 13px;
    font-size: 16px;
  }

  .form-field textarea {
    min-height: 130px;
  }

  .consent-field {
    align-items: flex-start;
    font-size: 12px;
    line-height: 1.45;
  }

  .lead-form > .btn {
    width: 100%;
    min-height: 52px;
  }

  /* Footer and overlays. */
  .site-footer {
    padding-top: 42px;
  }

  .site-footer .footer-topline {
    padding-bottom: 30px;
  }

  .site-footer .footer-main-grid {
    gap: 26px;
    padding-block: 32px;
  }

  .site-footer .footer-contact-card,
  .site-footer .footer-company-card {
    padding: 18px;
  }

  .site-footer .footer-contact-email {
    font-size: clamp(20px, 6vw, 27px);
    overflow-wrap: anywhere;
  }

  .site-footer .footer-bottom {
    grid-template-columns: 1fr;
    gap: 13px;
    align-items: start;
  }

  .site-footer .footer-lang-switch {
    justify-self: start;
  }

  .social-link {
    min-height: 38px;
    padding: 8px 10px;
  }

  .cookie-banner {
    max-height: min(72dvh, 520px);
    overflow-y: auto;
    padding: 15px;
  }

  .cookie-banner p {
    font-size: 13px;
    line-height: 1.45;
  }

  .cookie-actions {
    display: grid;
    grid-template-columns: 1fr 1fr;
  }

  body.has-cookie-banner .floating-contact {
    bottom: calc(170px + env(safe-area-inset-bottom));
  }
}

@media (max-width: 390px) {
  .container,
  .site-header .container {
    width: calc(100% - 22px);
  }

  .brand {
    max-width: 124px;
  }

  .brand-logo,
  .brand-logo img {
    max-width: 124px;
    max-height: 42px;
  }

  .lang-switch a {
    min-width: 29px;
    height: 36px;
    padding-inline: 4px;
  }

  .menu-toggle {
    flex-basis: 38px;
    width: 38px;
    height: 38px;
  }

  .hero-display-top {
    font-size: clamp(36px, 11.5vw, 44px);
  }

  .hero-display-bottom {
    font-size: clamp(34px, 10.8vw, 42px);
  }

  .direction-wall,
  #trusted .trusted-grid {
    grid-template-columns: 1fr;
  }

  .currency-button {
    min-height: 40px;
    font-size: 9px;
  }

  .cookie-actions {
    grid-template-columns: 1fr;
  }
}

/* 1.16.3 — stable mobile menu while scrolling and while browser chrome changes height. */
@media (max-width: 1080px) {
  .site-header {
    z-index: 10003;
    background: var(--paper);
    -webkit-backdrop-filter: none;
    backdrop-filter: none;
    transform: translateZ(0);
  }

  .admin-bar .site-header {
    top: 32px;
  }

  html.mobile-menu-open,
  body.mobile-menu-open {
    height: 100%;
    overflow: hidden !important;
    overscroll-behavior: none;
  }

  body.mobile-menu-open {
    touch-action: none;
  }

  .main-nav.main-nav--mobile-mounted {
    position: fixed;
    top: var(--tfac-mobile-nav-top, 76px);
    right: max(14px, env(safe-area-inset-right));
    bottom: auto;
    left: max(14px, env(safe-area-inset-left));
    z-index: 10002;
    display: flex;
    width: auto;
    max-height: calc(100dvh - var(--tfac-mobile-nav-top, 76px) - 14px);
    margin: 0;
    overflow-x: hidden;
    overflow-y: auto;
    overscroll-behavior: contain;
    -webkit-overflow-scrolling: touch;
    background: var(--paper);
    border: 2px solid var(--ink);
    box-shadow: 8px 8px 0 rgba(45, 45, 45, 0.2);
    opacity: 0;
    visibility: hidden;
    pointer-events: none;
    transform: translateY(-10px);
    transition:
      opacity 180ms ease,
      transform 220ms cubic-bezier(0.22, 1, 0.36, 1),
      visibility 0s linear 220ms;
  }

  .main-nav.main-nav--mobile-mounted.open {
    opacity: 1;
    visibility: visible;
    pointer-events: auto;
    transform: translateY(0);
    transition-delay: 0s;
    touch-action: pan-y;
  }

  .main-nav.main-nav--mobile-mounted a {
    flex: 0 0 auto;
  }

  .mobile-menu-backdrop {
    position: fixed;
    inset: 0;
    z-index: 10001;
    display: block;
    width: 100%;
    height: 100%;
    padding: 0;
    border: 0;
    background: rgba(45, 45, 45, 0.58);
    opacity: 0;
    visibility: hidden;
    pointer-events: none;
    transition:
      opacity 180ms ease,
      visibility 0s linear 180ms;
  }

  .mobile-menu-backdrop.open {
    opacity: 1;
    visibility: visible;
    pointer-events: auto;
    transition-delay: 0s;
  }

  .menu-toggle.is-open {
    background: var(--ink);
    color: var(--paper);
    font-size: 30px;
    line-height: 1;
  }
}

@media (max-width: 782px) {
  .admin-bar .site-header {
    top: 46px;
  }
}

@media (max-width: 760px) {
  .main-nav.main-nav--mobile-mounted {
    top: var(--tfac-mobile-nav-top, 64px);
    right: max(14px, env(safe-area-inset-right));
    left: max(14px, env(safe-area-inset-left));
    max-height: calc(100dvh - var(--tfac-mobile-nav-top, 64px) - 14px);
  }
}

@media (prefers-reduced-motion: reduce) {
  .main-nav.main-nav--mobile-mounted,
  .mobile-menu-backdrop {
    transition-duration: 1ms !important;
  }
}

/* 1.17.1 — cases section: remove decorative placeholder words and show a clear task/action/outcome hierarchy. */
#cases .section-head {
  align-items: end;
}

#cases .section-head > .lead {
  max-width: 430px;
  font-size: clamp(17px, 1.45vw, 22px);
  line-height: 1.35;
}

#cases .case-grid {
  align-items: stretch;
}

#cases .case-card {
  display: flex;
  flex-direction: column;
  min-height: 390px;
  padding: clamp(28px, 2.7vw, 42px);
}

#cases .case-card h3 {
  min-height: 0;
  max-width: 470px;
  margin: clamp(25px, 2.2vw, 34px) 0 clamp(30px, 2.8vw, 44px);
  font-size: clamp(29px, 2.4vw, 42px) !important;
  line-height: 0.94 !important;
}

#cases .case-metric {
  display: none !important;
}

#cases .case-detail {
  display: grid;
  gap: 8px;
  padding-top: 17px;
  border-top: 1px solid rgba(45, 45, 45, 0.24);
}

#cases .case-detail + .case-detail {
  margin-top: 20px;
}

#cases .case-detail-action {
  margin-top: auto;
}

#cases .case-detail-label {
  color: var(--acid);
  font-family: var(--tfac-font-body);
  font-size: 11px;
  font-weight: 900;
  line-height: 1;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

#cases .case-detail p,
#cases .case-detail strong {
  max-width: 100%;
  margin: 0;
  color: var(--ink);
  font-family: var(--tfac-font-body);
  font-size: clamp(16px, 1.35vw, 20px);
  line-height: 1.34;
}

#cases .case-detail strong {
  font-weight: 900;
}

#cases .case-card::after {
  opacity: 0.35;
}

@media (max-width: 980px) {
  #cases .case-grid {
    grid-template-columns: 1fr;
  }

  #cases .case-card {
    min-height: 0;
  }

  #cases .case-card h3 {
    max-width: 680px;
  }
}

@media (max-width: 700px) {
  #cases .section-head > .lead {
    justify-self: start;
    max-width: 100%;
    margin-top: 12px;
  }

  #cases .case-card {
    padding: 24px 20px;
  }

  #cases .case-card h3 {
    margin: 22px 0 28px;
    font-size: clamp(28px, 9.2vw, 38px) !important;
  }

  #cases .case-detail p,
  #cases .case-detail strong {
    font-size: 16px;
  }
}


/* 1.17.4 — SMM and web service coverage. */
.service-row:nth-child(4) .service-main h3,
.service-row:nth-child(5) .service-main h3,
.service-row:nth-child(8) .service-main h3 {
  font-size: clamp(28px, 3.15vw, 48px);
  overflow-wrap: anywhere;
}

@media (max-width: 700px) {
  .service-row:nth-child(4) .service-main h3,
  .service-row:nth-child(5) .service-main h3,
  .service-row:nth-child(8) .service-main h3 {
    font-size: clamp(24px, 7vw, 30px) !important;
  }
}